(5-hydroxy-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,4a,5,8-hexahydro-1H-naphthalen-2-yl) 2-methylbut-2-enoate
Internal ID | 313201b6-ece1-4fb4-827b-7494ee91760c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
IUPAC Name | (5-hydroxy-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,4a,5,8-hexahydro-1H-naphthalen-2-yl) 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CCC2C(C(=O)C(=C(C)C)CC2(C1C)C)O |
SMILES (Isomeric) | CC=C(C)C(=O)OC1CCC2C(C(=O)C(=C(C)C)CC2(C1C)C)O |
InChI | InChI=1S/C20H30O4/c1-7-12(4)19(23)24-16-9-8-15-18(22)17(21)14(11(2)3)10-20(15,6)13(16)5/h7,13,15-16,18,22H,8-10H2,1-6H3 |
InChI Key | CLJHBJSNZHKDCS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H30O4 |
Molecular Weight | 334.40 g/mol |
Exact Mass | 334.21440943 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 4.30 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.34% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.76% | 96.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.03% | 91.19% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.87% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.25% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 88.14% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.55% | 90.17% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.41% | 93.04% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 86.14% | 85.30% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.83% | 91.07% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.65% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.42% | 99.23% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.10% | 93.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.29% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.15% | 97.25% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 82.78% | 97.47% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.17% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.33% | 92.94% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 80.76% | 92.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senecio grisebachii |
Senecio ochoanus |
PubChem | 162949892 |
LOTUS | LTS0211757 |
wikiData | Q104963507 |