16-Benzyl-11,20-dimethyl-3-(2-methylpropyl)-10,13-di(propan-2-yl)-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone
| Internal ID | affffcd4-3bb5-45b1-bcbb-f34cb9dac5d2 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 16-benzyl-11,20-dimethyl-3-(2-methylpropyl)-10,13-di(propan-2-yl)-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone |
| SMILES (Canonical) | CC1CCN2C1C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)NCCC(=O)OC(C2=O)CC(C)C)C(C)C)C)C(C)C)CC3=CC=CC=C3 |
| SMILES (Isomeric) | CC1CCN2C1C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)NCCC(=O)OC(C2=O)CC(C)C)C(C)C)C)C(C)C)CC3=CC=CC=C3 |
| InChI | InChI=1S/C35H53N5O7/c1-20(2)18-26-34(45)40-17-15-23(7)30(40)33(44)37-25(19-24-12-10-9-11-13-24)31(42)38-28(21(3)4)35(46)39(8)29(22(5)6)32(43)36-16-14-27(41)47-26/h9-13,20-23,25-26,28-30H,14-19H2,1-8H3,(H,36,43)(H,37,44)(H,38,42) |
| InChI Key | YCGVVPXVWFYGHR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H53N5O7 |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.39449905 g/mol |
| Topological Polar Surface Area (TPSA) | 154.00 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.73% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.37% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.31% | 95.56% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.90% | 97.64% |
| CHEMBL3837 | P07711 | Cathepsin L | 92.47% | 96.61% |
| CHEMBL228 | P31645 | Serotonin transporter | 91.56% | 95.51% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 90.63% | 96.31% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 88.99% | 90.08% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.89% | 97.25% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 87.91% | 94.66% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.85% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.53% | 95.89% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.48% | 95.93% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.08% | 97.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.82% | 86.33% |
| CHEMBL4616 | Q92847 | Ghrelin receptor | 86.05% | 92.00% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 85.65% | 90.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.41% | 97.09% |
| CHEMBL4072 | P07858 | Cathepsin B | 84.49% | 93.67% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.42% | 98.59% |
| CHEMBL1949 | P62937 | Cyclophilin A | 84.38% | 98.57% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.95% | 96.25% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.85% | 96.47% |
| CHEMBL2189110 | Q15910 | Histone-lysine N-methyltransferase EZH2 | 82.65% | 97.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.96% | 93.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.41% | 90.71% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.25% | 95.89% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.18% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 78167201 |
| LOTUS | LTS0017748 |
| wikiData | Q104201561 |