CID 74951518
| Internal ID | d83c9098-f3d8-4415-9c9f-5bb77e6e2e8c |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | N-[2-[[6-amino-1-oxo-1-[[3,6,9,12-tetrakis(4-aminobutyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclononadec-15-yl]amino]hexan-2-yl]amino]-2-oxoethyl]-3-hydroxy-13-methyltetradecanamide |
| SMILES (Canonical) | CC(C)CCCCCCCCCC(CC(=O)NCC(=O)NC(CCCCN)C(=O)NC1CCCCNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CCCCN)CCCCN)CCCCN)CCCCN)O |
| SMILES (Isomeric) | CC(C)CCCCCCCCCC(CC(=O)NCC(=O)NC(CCCCN)C(=O)NC1CCCCNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CCCCN)CCCCN)CCCCN)CCCCN)O |
| InChI | InChI=1S/C53H103N13O9/c1-38(2)22-8-6-4-3-5-7-9-23-39(67)36-46(68)60-37-47(69)61-41(25-11-17-31-55)49(71)63-45-29-15-21-35-59-48(70)40(24-10-16-30-54)62-50(72)42(26-12-18-32-56)64-51(73)43(27-13-19-33-57)65-52(74)44(66-53(45)75)28-14-20-34-58/h38-45,67H,3-37,54-58H2,1-2H3,(H,59,70)(H,60,68)(H,61,69)(H,62,72)(H,63,71)(H,64,73)(H,65,74)(H,66,75) |
| InChI Key | VCTKHYFQPAGIHS-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C53H103N13O9 |
| Molecular Weight | 1066.50 g/mol |
| Exact Mass | 1065.80017191 g/mol |
| Topological Polar Surface Area (TPSA) | 383.00 Ų |
| XlogP | 1.80 |
| Atomic LogP (AlogP) | 0.87 |
| H-Bond Acceptor | 14 |
| H-Bond Donor | 14 |
| Rotatable Bonds | 37 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5055 | 50.55% |
| Caco-2 | - | 0.8576 | 85.76% |
| Blood Brain Barrier | - | 0.8000 | 80.00% |
| Human oral bioavailability | - | 0.6000 | 60.00% |
| Subcellular localzation | Mitochondria | 0.5201 | 52.01% |
| OATP2B1 inhibitior | - | 0.5710 | 57.10% |
| OATP1B1 inhibitior | + | 0.9051 | 90.51% |
| OATP1B3 inhibitior | + | 0.9153 | 91.53% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.9537 | 95.37% |
| BSEP inhibitior | + | 0.8915 | 89.15% |
| P-glycoprotein inhibitior | + | 0.7406 | 74.06% |
| P-glycoprotein substrate | + | 0.8572 | 85.72% |
| CYP3A4 substrate | + | 0.6645 | 66.45% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7691 | 76.91% |
| CYP3A4 inhibition | - | 0.9695 | 96.95% |
| CYP2C9 inhibition | - | 0.9549 | 95.49% |
| CYP2C19 inhibition | - | 0.9286 | 92.86% |
| CYP2D6 inhibition | - | 0.9347 | 93.47% |
| CYP1A2 inhibition | - | 0.9497 | 94.97% |
| CYP2C8 inhibition | - | 0.6471 | 64.71% |
| CYP inhibitory promiscuity | - | 0.9960 | 99.60% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8300 | 83.00% |
| Carcinogenicity (trinary) | Non-required | 0.6466 | 64.66% |
| Eye corrosion | - | 0.9824 | 98.24% |
| Eye irritation | - | 0.8951 | 89.51% |
| Skin irritation | - | 0.7654 | 76.54% |
| Skin corrosion | - | 0.9251 | 92.51% |
| Ames mutagenesis | - | 0.6878 | 68.78% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4129 | 41.29% |
| Micronuclear | + | 0.7500 | 75.00% |
| Hepatotoxicity | - | 0.6125 | 61.25% |
| skin sensitisation | - | 0.8843 | 88.43% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.7778 | 77.78% |
| Mitochondrial toxicity | + | 0.6750 | 67.50% |
| Nephrotoxicity | - | 0.5970 | 59.70% |
| Acute Oral Toxicity (c) | III | 0.7582 | 75.82% |
| Estrogen receptor binding | + | 0.7429 | 74.29% |
| Androgen receptor binding | + | 0.6583 | 65.83% |
| Thyroid receptor binding | - | 0.4879 | 48.79% |
| Glucocorticoid receptor binding | - | 0.4645 | 46.45% |
| Aromatase binding | + | 0.6597 | 65.97% |
| PPAR gamma | + | 0.6779 | 67.79% |
| Honey bee toxicity | - | 0.8521 | 85.21% |
| Biodegradation | - | 0.6500 | 65.00% |
| Crustacea aquatic toxicity | - | 0.5163 | 51.63% |
| Fish aquatic toxicity | - | 0.7703 | 77.03% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.52% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.27% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.04% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.00% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.72% | 97.09% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 96.71% | 97.23% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 96.34% | 98.05% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 94.50% | 96.11% |
| CHEMBL236 | P41143 | Delta opioid receptor | 94.20% | 99.35% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 93.84% | 98.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.77% | 90.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.29% | 90.08% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 92.91% | 93.18% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 92.41% | 96.33% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 91.91% | 98.24% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 91.78% | 88.42% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 91.48% | 92.88% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.01% | 93.10% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.95% | 95.50% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 90.94% | 96.67% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 90.92% | 94.66% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.58% | 85.14% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.64% | 97.29% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 89.40% | 89.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.92% | 93.56% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.34% | 95.93% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 88.11% | 82.86% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.55% | 99.17% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.38% | 89.50% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 87.33% | 95.38% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.31% | 82.69% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 87.25% | 94.55% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 87.23% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.23% | 96.47% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 87.07% | 95.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.46% | 100.00% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 84.77% | 95.71% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.36% | 90.20% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.32% | 90.17% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 84.27% | 95.92% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.83% | 94.33% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.57% | 100.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.22% | 96.90% |
| CHEMBL2593 | P30419 | Peptide N-myristoyltransferase 1 | 82.18% | 93.45% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.08% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.95% | 97.14% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.87% | 95.56% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 81.57% | 94.50% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.44% | 91.03% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.35% | 93.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.23% | 93.03% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 81.16% | 98.10% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 80.66% | 80.71% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 80.21% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Duguetia staudtii |
| PubChem | 74951518 |
| LOTUS | LTS0001841 |
| wikiData | Q105027062 |