[(1S,4aR,5R,7S,7aS)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-5-yl] (E)-3-[4-[(1R,2S)-1,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy-3-methoxyphenyl]prop-2-enoate
Internal ID | 9b24d9b3-19ec-4f16-a76d-f49bee7caaad |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | [(1S,4aR,5R,7S,7aS)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-5-yl] (E)-3-[4-[(1R,2S)-1,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy-3-methoxyphenyl]prop-2-enoate |
SMILES (Canonical) | CC1(CC(C2C1C(OC=C2)OC3C(C(C(C(O3)CO)O)O)O)OC(=O)C=CC4=CC(=C(C=C4)OC(CO)C(C5=CC(=C(C=C5)O)OC)O)OC)O |
SMILES (Isomeric) | C[C@@]1(C[C@H]([C@H]2[C@@H]1[C@@H](OC=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)OC(=O)/C=C/C4=CC(=C(C=C4)O[C@@H](CO)[C@@H](C5=CC(=C(C=C5)O)OC)O)OC)O |
InChI | InChI=1S/C35H44O16/c1-35(44)14-24(19-10-11-47-33(28(19)35)51-34-32(43)31(42)30(41)26(16-37)50-34)49-27(39)9-5-17-4-8-21(23(12-17)46-3)48-25(15-36)29(40)18-6-7-20(38)22(13-18)45-2/h4-13,19,24-26,28-34,36-38,40-44H,14-16H2,1-3H3/b9-5+/t19-,24+,25-,26+,28+,29+,30+,31-,32+,33-,34-,35-/m0/s1 |
InChI Key | JIVIWZFMKMYTDB-PBTQMVEBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H44O16 |
Molecular Weight | 720.70 g/mol |
Exact Mass | 720.26293531 g/mol |
Topological Polar Surface Area (TPSA) | 244.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
![2D Structure of [(1S,4aR,5R,7S,7aS)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-5-yl] (E)-3-[4-[(1R,2S)-1,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy-3-methoxyphenyl]prop-2-enoate 2D Structure of [(1S,4aR,5R,7S,7aS)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-5-yl] (E)-3-[4-[(1R,2S)-1,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy-3-methoxyphenyl]prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/52e427d0-874e-11ee-a79a-456dfa55c6d0.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.43% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.35% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.88% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.70% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.83% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.69% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.90% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.17% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.62% | 94.45% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.60% | 89.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.81% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.63% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 88.09% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.77% | 99.17% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.76% | 96.21% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.46% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.93% | 95.89% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.15% | 89.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.93% | 91.07% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.92% | 97.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.06% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.29% | 86.92% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.02% | 92.62% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.02% | 82.50% |
CHEMBL220 | P22303 | Acetylcholinesterase | 80.65% | 94.45% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.30% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Buddleja davidii |
PubChem | 163193079 |
LOTUS | LTS0055387 |
wikiData | Q105129371 |