3-hydroxy-17-(6-methoxy-6-methylhept-4-en-2-yl)-4,4,13,14-tetramethyl-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-9-carbaldehyde
Internal ID | 1514ee0b-2bbf-4952-8c64-ca2687a6fa45 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | 3-hydroxy-17-(6-methoxy-6-methylhept-4-en-2-yl)-4,4,13,14-tetramethyl-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-9-carbaldehyde |
SMILES (Canonical) | CC(CC=CC(C)(C)OC)C1CCC2(C1(CCC3(C2C(C=C4C3CCC(C4(C)C)O)OC5C(C(C(C(O5)CO)O)O)O)C=O)C)C |
SMILES (Isomeric) | CC(CC=CC(C)(C)OC)C1CCC2(C1(CCC3(C2C(C=C4C3CCC(C4(C)C)O)OC5C(C(C(C(O5)CO)O)O)O)C=O)C)C |
InChI | InChI=1S/C37H60O9/c1-21(10-9-14-33(2,3)44-8)22-13-15-36(7)31-25(45-32-30(43)29(42)28(41)26(19-38)46-32)18-24-23(11-12-27(40)34(24,4)5)37(31,20-39)17-16-35(22,36)6/h9,14,18,20-23,25-32,38,40-43H,10-13,15-17,19H2,1-8H3 |
InChI Key | HPSVQEWDZSDXRG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H60O9 |
Molecular Weight | 648.90 g/mol |
Exact Mass | 648.42373349 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | 3.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.13% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.11% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.75% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.47% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.40% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.79% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.71% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 89.66% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.62% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.14% | 86.33% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.65% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.60% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.30% | 91.07% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.68% | 97.36% |
CHEMBL5028 | O14672 | ADAM10 | 83.20% | 97.50% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.50% | 94.75% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.27% | 97.14% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.83% | 92.86% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.46% | 98.05% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.20% | 96.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.15% | 93.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.91% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.60% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica charantia |
PubChem | 76512703 |
LOTUS | LTS0237032 |
wikiData | Q105031872 |