11-Methoxy-4,4,7a,10,10,13a,15b-heptamethyl-2,3,4,4a,5,7,7a,8,9,9a,10,11,12,13,13a,13b,14,15,15a,15b-icosahydro-1h-cyclohepta[1,2-a:5,4-a']dinaphthalen-3-ol
Internal ID | 5fe09fdc-9fbf-4229-b24f-88e35cdf01b7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 19-methoxy-1,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-8-ol |
SMILES (Canonical) | CC1(C2CCC3(CC4=CCC5C(C(CCC5(C4CCC3C2(CCC1OC)C)C)O)(C)C)C)C |
SMILES (Isomeric) | CC1(C2CCC3(CC4=CCC5C(C(CCC5(C4CCC3C2(CCC1OC)C)C)O)(C)C)C)C |
InChI | InChI=1S/C31H52O2/c1-27(2)22-11-9-20-19-29(5)16-13-23-28(3,4)26(33-8)15-18-31(23,7)24(29)12-10-21(20)30(22,6)17-14-25(27)32/h9,21-26,32H,10-19H2,1-8H3 |
InChI Key | HADVFQOSVABMHT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H52O2 |
Molecular Weight | 456.70 g/mol |
Exact Mass | 456.396730897 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 8.10 |
11-methoxy-4,4,7a,10,10,13a,15b-heptamethyl-2,3,4,4a,5,7,7a,8,9,9a,10,11,12,13,13a,13b,14,15,15a,15b-icosahydro-1h-cyclohepta[1,2-a:5,4-a']dinaphthalen-3-ol |
NSC129992 |
19902-63-7 |
DTXSID20941784 |
NSC129989 |
NSC-129989 |
NSC-129992 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.80% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.89% | 95.89% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 91.65% | 85.30% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.61% | 91.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.47% | 94.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.05% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.86% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.55% | 92.94% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.64% | 90.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.07% | 94.45% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 85.21% | 85.49% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.25% | 83.82% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.03% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Picea jezoensis |
Picea sitchensis |
Pinus armandii |
Pinus luchuensis |
PubChem | 279464 |
LOTUS | LTS0173042 |
wikiData | Q82918694 |