methyl (2S,3R,4R)-3-ethenyl-4-[[(2S,6S)-6-[4-(4-hydroxyphenyl)-2-oxobutyl]-4-oxooxan-2-yl]methyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate
Internal ID | 56751901-9f70-46c4-9107-f66410fa2f38 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | methyl (2S,3R,4R)-3-ethenyl-4-[[(2S,6S)-6-[4-(4-hydroxyphenyl)-2-oxobutyl]-4-oxooxan-2-yl]methyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate |
SMILES (Canonical) | COC(=O)C1=COC(C(C1CC2CC(=O)CC(O2)CC(=O)CCC3=CC=C(C=C3)O)C=C)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC(=O)C1=CO[C@H]([C@@H]([C@H]1C[C@H]2CC(=O)C[C@@H](O2)CC(=O)CCC3=CC=C(C=C3)O)C=C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C31H40O13/c1-3-22-23(13-21-12-19(35)11-20(42-21)10-18(34)9-6-16-4-7-17(33)8-5-16)24(29(39)40-2)15-41-30(22)44-31-28(38)27(37)26(36)25(14-32)43-31/h3-5,7-8,15,20-23,25-28,30-33,36-38H,1,6,9-14H2,2H3/t20-,21+,22+,23+,25+,26+,27-,28+,30-,31-/m0/s1 |
InChI Key | BAKYVUHOODEWGV-OYLIQCHPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H40O13 |
Molecular Weight | 620.60 g/mol |
Exact Mass | 620.24689133 g/mol |
Topological Polar Surface Area (TPSA) | 199.00 Ų |
XlogP | -0.10 |
There are no found synonyms. |
![2D Structure of methyl (2S,3R,4R)-3-ethenyl-4-[[(2S,6S)-6-[4-(4-hydroxyphenyl)-2-oxobutyl]-4-oxooxan-2-yl]methyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate 2D Structure of methyl (2S,3R,4R)-3-ethenyl-4-[[(2S,6S)-6-[4-(4-hydroxyphenyl)-2-oxobutyl]-4-oxooxan-2-yl]methyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/52b6bba0-8359-11ee-b239-6135209bb7aa.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.84% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.31% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.87% | 96.09% |
CHEMBL220 | P22303 | Acetylcholinesterase | 95.36% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.07% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.92% | 94.73% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 89.87% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.26% | 95.89% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 88.65% | 85.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.25% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.07% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.62% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.21% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.93% | 94.45% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 83.88% | 97.03% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.63% | 89.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.25% | 95.83% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.03% | 96.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.75% | 93.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.59% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.11% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.72% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hydrangea chinensis |
PubChem | 154496747 |
LOTUS | LTS0091164 |
wikiData | Q104922271 |