(2-Acetyloxy-3,10,14-trihydroxy-4,15,15-trimethyl-8-methylidene-13-oxo-7-tetracyclo[9.3.1.01,9.04,9]pentadecanyl) 3-phenylprop-2-enoate
Internal ID | 3f198b77-7b4e-4538-8585-d3165af0e0cc |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters |
IUPAC Name | (2-acetyloxy-3,10,14-trihydroxy-4,15,15-trimethyl-8-methylidene-13-oxo-7-tetracyclo[9.3.1.01,9.04,9]pentadecanyl) 3-phenylprop-2-enoate |
SMILES (Canonical) | CC(=O)OC1C(C2(CCC(C(=C)C23C14C(C(=O)CC(C3O)C4(C)C)O)OC(=O)C=CC5=CC=CC=C5)C)O |
SMILES (Isomeric) | CC(=O)OC1C(C2(CCC(C(=C)C23C14C(C(=O)CC(C3O)C4(C)C)O)OC(=O)C=CC5=CC=CC=C5)C)O |
InChI | InChI=1S/C30H36O8/c1-16-21(38-22(33)12-11-18-9-7-6-8-10-18)13-14-28(5)25(36)26(37-17(2)31)30-24(35)20(32)15-19(27(30,3)4)23(34)29(16,28)30/h6-12,19,21,23-26,34-36H,1,13-15H2,2-5H3 |
InChI Key | MALVGAXITHSCSM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H36O8 |
Molecular Weight | 524.60 g/mol |
Exact Mass | 524.24101810 g/mol |
Topological Polar Surface Area (TPSA) | 130.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.61% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.16% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.01% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.85% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.56% | 96.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.83% | 94.62% |
CHEMBL2581 | P07339 | Cathepsin D | 92.25% | 98.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.46% | 95.50% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 87.40% | 94.08% |
CHEMBL5028 | O14672 | ADAM10 | 86.63% | 97.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.01% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.22% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.48% | 94.45% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.09% | 93.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.82% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.58% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus baccata |
PubChem | 163039586 |
LOTUS | LTS0168667 |
wikiData | Q105160414 |