[(1S,2S,3R,4R,5S,7S,8R,11S,17S)-4-hydroxy-4,8,11-trimethyl-15-methylidene-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-5-yl] octanoate
| Internal ID | 510bcacc-9b41-42dd-9824-8943c57612bd |
| Taxonomy | Organoheterocyclic compounds > Oxepanes |
| IUPAC Name | [(1S,2S,3R,4R,5S,7S,8R,11S,17S)-4-hydroxy-4,8,11-trimethyl-15-methylidene-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-5-yl] octanoate |
| SMILES (Canonical) | CCCCCCCC(=O)OC1CC2C(COC3(CCCC(=C)CC4C(C2C3O4)C1(C)O)C)C |
| SMILES (Isomeric) | CCCCCCCC(=O)O[C@H]1C[C@H]2[C@H](CO[C@]3(CCCC(=C)C[C@H]4[C@@H]([C@H]2[C@@H]3O4)[C@@]1(C)O)C)C |
| InChI | InChI=1S/C28H46O5/c1-6-7-8-9-10-13-23(29)33-22-16-20-19(3)17-31-27(4)14-11-12-18(2)15-21-25(28(22,5)30)24(20)26(27)32-21/h19-22,24-26,30H,2,6-17H2,1,3-5H3/t19-,20-,21-,22-,24-,25-,26-,27-,28-/m0/s1 |
| InChI Key | GGABJCIMEQXKJD-PLDABBGUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.33452456 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.91% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.74% | 91.11% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 95.87% | 98.03% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 95.10% | 97.79% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.09% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.77% | 97.25% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.30% | 89.63% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.80% | 86.33% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 92.06% | 92.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.83% | 99.17% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 91.74% | 92.86% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.44% | 91.19% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.38% | 95.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.04% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.28% | 92.94% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.75% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.59% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.43% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.87% | 100.00% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 86.35% | 89.05% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 86.27% | 82.50% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 85.92% | 97.63% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.30% | 92.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.78% | 89.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.05% | 93.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.07% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.36% | 99.23% |
| CHEMBL5028 | O14672 | ADAM10 | 81.18% | 97.50% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 80.47% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10790241 |
| LOTUS | LTS0153711 |
| wikiData | Q105007933 |