[(1S,2S,3R,4R,6S)-4-[(3S)-4-[(2R)-3,3-dimethyloxiran-2-yl]-3-[(Z)-2-methylbut-2-enoyl]oxybut-1-en-2-yl]-3-hydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl] (Z)-2-methylbut-2-enoate
Internal ID | 33d545ea-b5a0-4563-8020-d8faef076033 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | [(1S,2S,3R,4R,6S)-4-[(3S)-4-[(2R)-3,3-dimethyloxiran-2-yl]-3-[(Z)-2-methylbut-2-enoyl]oxybut-1-en-2-yl]-3-hydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl] (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C(C(CC2C1(O2)C)C(=C)C(CC3C(O3)(C)C)OC(=O)C(=CC)C)O |
SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@H]1[C@@H]([C@H](C[C@H]2[C@@]1(O2)C)C(=C)[C@H](C[C@@H]3C(O3)(C)C)OC(=O)/C(=C\C)/C)O |
InChI | InChI=1S/C25H36O7/c1-9-13(3)22(27)29-17(12-18-24(6,7)31-18)15(5)16-11-19-25(8,32-19)21(20(16)26)30-23(28)14(4)10-2/h9-10,16-21,26H,5,11-12H2,1-4,6-8H3/b13-9-,14-10-/t16-,17+,18-,19+,20-,21+,25+/m1/s1 |
InChI Key | SOLKVQDUFSZHNA-OQPCPOJHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H36O7 |
Molecular Weight | 448.50 g/mol |
Exact Mass | 448.24610348 g/mol |
Topological Polar Surface Area (TPSA) | 97.90 Ų |
XlogP | 3.60 |
There are no found synonyms. |
![2D Structure of [(1S,2S,3R,4R,6S)-4-[(3S)-4-[(2R)-3,3-dimethyloxiran-2-yl]-3-[(Z)-2-methylbut-2-enoyl]oxybut-1-en-2-yl]-3-hydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl] (Z)-2-methylbut-2-enoate 2D Structure of [(1S,2S,3R,4R,6S)-4-[(3S)-4-[(2R)-3,3-dimethyloxiran-2-yl]-3-[(Z)-2-methylbut-2-enoyl]oxybut-1-en-2-yl]-3-hydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl] (Z)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/523582e0-8506-11ee-98ac-91c0c5eb7637.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.44% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.51% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.25% | 94.45% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.68% | 91.19% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 90.05% | 91.24% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 89.57% | 98.75% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.39% | 91.07% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.28% | 83.82% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.21% | 96.95% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 85.16% | 82.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.64% | 94.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.58% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.34% | 97.25% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.86% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 82.61% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.96% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.32% | 93.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.18% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.05% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.95% | 89.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.92% | 90.17% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.85% | 95.17% |
CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 80.75% | 80.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligularia cymbulifera |
PubChem | 163019805 |
LOTUS | LTS0240214 |
wikiData | Q105257033 |