5,2'-Dihydroxy-6,7-methylenedioxyflavanone
| Internal ID | 072ffe6b-cbf9-4ccf-946b-ae7b0284f1e8 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Flavanones |
| IUPAC Name | (6S)-9-hydroxy-6-(2-hydroxyphenyl)-6,7-dihydro-[1,3]dioxolo[4,5-g]chromen-8-one |
| SMILES (Canonical) | C1C(OC2=CC3=C(C(=C2C1=O)O)OCO3)C4=CC=CC=C4O |
| SMILES (Isomeric) | C1[C@H](OC2=CC3=C(C(=C2C1=O)O)OCO3)C4=CC=CC=C4O |
| InChI | InChI=1S/C16H12O6/c17-9-4-2-1-3-8(9)11-5-10(18)14-12(22-11)6-13-16(15(14)19)21-7-20-13/h1-4,6,11,17,19H,5,7H2/t11-/m0/s1 |
| InChI Key | CFAXKRNPHJYYNQ-NSHDSACASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 85.20 Ų |
| XlogP | 2.60 |
| LMPK12140602 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.58% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.07% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.05% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.90% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.47% | 89.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.91% | 93.40% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.85% | 99.23% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.73% | 93.99% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 87.28% | 81.29% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.22% | 99.15% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.87% | 92.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.82% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Iris tenuifolia |
| PubChem | 42608090 |
| LOTUS | LTS0134650 |
| wikiData | Q76535203 |