7,9-Dihydroxy-3-(1h-indol-3-ylmethyl)-8-methoxy-2,3,11,11a-tetrahydro-6h-pyrazino[1,2-b]isoquinoline-1,4-dione
| Internal ID | c402a3ed-b328-4217-9e3c-2b6f653f925c |
| Taxonomy | Organoheterocyclic compounds > Tetrahydroisoquinolines |
| IUPAC Name | (3R,11aR)-7,9-dihydroxy-3-(1H-indol-3-ylmethyl)-8-methoxy-3,6,11,11a-tetrahydro-2H-pyrazino[1,2-b]isoquinoline-1,4-dione |
| SMILES (Canonical) | COC1=C(C=C2CC3C(=O)NC(C(=O)N3CC2=C1O)CC4=CNC5=CC=CC=C54)O |
| SMILES (Isomeric) | COC1=C(C=C2C[C@@H]3C(=O)N[C@@H](C(=O)N3CC2=C1O)CC4=CNC5=CC=CC=C54)O |
| InChI | InChI=1S/C22H21N3O5/c1-30-20-18(26)8-11-7-17-21(28)24-16(22(29)25(17)10-14(11)19(20)27)6-12-9-23-15-5-3-2-4-13(12)15/h2-5,8-9,16-17,23,26-27H,6-7,10H2,1H3,(H,24,28)/t16-,17-/m1/s1 |
| InChI Key | FBGQHXBBNVDHIX-IAGOWNOFSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.14812078 g/mol |
| Topological Polar Surface Area (TPSA) | 115.00 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
![2D Structure of 7,9-Dihydroxy-3-(1h-indol-3-ylmethyl)-8-methoxy-2,3,11,11a-tetrahydro-6h-pyrazino[1,2-b]isoquinoline-1,4-dione](https://plantaedb.com/storage/docs/compounds/2023/11/51b7c700-8600-11ee-b64f-790aa8e4e885.jpg "2D Structure of 7,9-Dihydroxy-3-(1h-indol-3-ylmethyl)-8-methoxy-2,3,11,11a-tetrahydro-6h-pyrazino[1,2-b]isoquinoline-1,4-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.86% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.32% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.80% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.66% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.27% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.47% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.51% | 94.45% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 93.47% | 95.62% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 93.31% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.13% | 93.99% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.72% | 92.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.23% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.70% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.50% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.39% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.58% | 97.09% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 87.37% | 96.39% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 85.18% | 97.05% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.29% | 89.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.97% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.55% | 99.23% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.40% | 82.38% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.61% | 88.56% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 80.25% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139583167 |
| LOTUS | LTS0102462 |
| wikiData | Q75055187 |