(2S)-2-[[(17R,20R,23R,26R,29S)-20,26-bis(3,5-dichloro-4-hydroxyphenyl)-17-[[2-(3,5-dichloro-4-hydroxyphenyl)-2-oxoacetyl]amino]-37-hydroxy-28-methyl-18,21,24,27-tetraoxo-2-oxa-13,19,22,25,28-pentazahexacyclo[29.2.2.13,7.18,12.05,23.011,15]heptatriaconta-1(33),3,5,7(37),8(36),9,11,14,31,34-decaene-29-carbonyl]amino]-2-(4-hydroxyphenyl)acetic acid
| Internal ID | 7b6a3a1e-bf4c-4206-a0ed-7631721d0a30 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (2S)-2-[[(17R,20R,23R,26R,29S)-20,26-bis(3,5-dichloro-4-hydroxyphenyl)-17-[[2-(3,5-dichloro-4-hydroxyphenyl)-2-oxoacetyl]amino]-37-hydroxy-28-methyl-18,21,24,27-tetraoxo-2-oxa-13,19,22,25,28-pentazahexacyclo[29.2.2.13,7.18,12.05,23.011,15]heptatriaconta-1(33),3,5,7(37),8(36),9,11,14,31,34-decaene-29-carbonyl]amino]-2-(4-hydroxyphenyl)acetic acid |
| SMILES (Canonical) | CN1C(CC2=CC=C(C=C2)OC3=CC4=CC(=C3O)C5=CC6=C(C=C5)C(=CN6)CC(C(=O)NC(C(=O)NC4C(=O)NC(C1=O)C7=CC(=C(C(=C7)Cl)O)Cl)C8=CC(=C(C(=C8)Cl)O)Cl)NC(=O)C(=O)C9=CC(=C(C(=C9)Cl)O)Cl)C(=O)NC(C1=CC=C(C=C1)O)C(=O)O |
| SMILES (Isomeric) | CN1[C@@H](CC2=CC=C(C=C2)OC3=CC4=CC(=C3O)C5=CC6=C(C=C5)C(=CN6)C[C@H](C(=O)N[C@@H](C(=O)N[C@H]4C(=O)N[C@@H](C1=O)C7=CC(=C(C(=C7)Cl)O)Cl)C8=CC(=C(C(=C8)Cl)O)Cl)NC(=O)C(=O)C9=CC(=C(C(=C9)Cl)O)Cl)C(=O)N[C@@H](C1=CC=C(C=C1)O)C(=O)O |
| InChI | InChI=1S/C61H45Cl6N7O15/c1-74-44(56(82)73-49(61(87)88)25-4-7-32(75)8-5-25)12-24-2-9-33(10-3-24)89-45-22-27-13-35(51(45)77)26-6-11-34-31(23-68-42(34)20-26)21-43(69-59(85)50(76)30-18-40(66)54(80)41(67)19-30)55(81)70-47(28-14-36(62)52(78)37(63)15-28)57(83)71-46(27)58(84)72-48(60(74)86)29-16-38(64)53(79)39(65)17-29/h2-11,13-20,22-23,43-44,46-49,68,75,77-80H,12,21H2,1H3,(H,69,85)(H,70,81)(H,71,83)(H,72,84)(H,73,82)(H,87,88)/t43-,44+,46-,47-,48-,49+/m1/s1 |
| InChI Key | JJGZGELTZPACID-OZJJKODVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C61H45Cl6N7O15 |
| Molecular Weight | 1328.80 g/mol |
| Exact Mass | 1327.107530 g/mol |
| Topological Polar Surface Area (TPSA) | 346.00 Ų |
| XlogP | 9.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.56% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.29% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.92% | 96.09% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 96.25% | 98.35% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 94.53% | 85.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.78% | 89.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 93.35% | 95.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.58% | 90.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.35% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.46% | 95.89% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 90.63% | 96.39% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 90.22% | 92.29% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.07% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.50% | 86.33% |
| CHEMBL236 | P41143 | Delta opioid receptor | 89.33% | 99.35% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 88.94% | 88.42% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 88.70% | 97.56% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 87.72% | 85.00% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 87.35% | 80.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.14% | 94.45% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 86.82% | 100.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 86.77% | 96.61% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 86.20% | 94.45% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.16% | 95.78% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.95% | 94.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.53% | 91.19% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.34% | 95.56% |
| CHEMBL204 | P00734 | Thrombin | 85.31% | 96.01% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.70% | 99.15% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 83.65% | 97.31% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 83.28% | 96.76% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.84% | 97.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.77% | 89.62% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 82.59% | 96.31% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.39% | 95.71% |
| CHEMBL5314 | Q06418 | Tyrosine-protein kinase receptor TYRO3 | 82.36% | 96.00% |
| CHEMBL4422 | O14842 | Free fatty acid receptor 1 | 82.33% | 93.33% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 81.50% | 97.50% |
| CHEMBL2083 | P15090 | Fatty acid binding protein adipocyte | 81.16% | 95.71% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.03% | 93.40% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 80.15% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 122361493 |
| LOTUS | LTS0052578 |
| wikiData | Q105129654 |