(4aS,8R,14S,14aR)-1,4a,7-trihydroxy-2,2,4,4,10,10,12,12-octamethyl-6-(2-methylpropanoyl)-8,14-di(propan-2-yl)-1,8,14,14a-tetrahydrochromeno[2,3-a]xanthene-3,9,11-trione
| Internal ID | 0e8c6878-d4ff-47fe-a2e5-db3affa88bf9 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthenes |
| IUPAC Name | (4aS,8R,14S,14aR)-1,4a,7-trihydroxy-2,2,4,4,10,10,12,12-octamethyl-6-(2-methylpropanoyl)-8,14-di(propan-2-yl)-1,8,14,14a-tetrahydrochromeno[2,3-a]xanthene-3,9,11-trione |
| SMILES (Canonical) | CC(C)C1C2C(C(C(=O)C(C2(OC3=C(C(=C4C(C5=C(C(C(=O)C(C5=O)(C)C)(C)C)OC4=C13)C(C)C)O)C(=O)C(C)C)O)(C)C)(C)C)O |
| SMILES (Isomeric) | CC(C)[C@H]1[C@@H]2C(C(C(=O)C([C@]2(OC3=C(C(=C4[C@H](C5=C(C(C(=O)C(C5=O)(C)C)(C)C)OC4=C13)C(C)C)O)C(=O)C(C)C)O)(C)C)(C)C)O |
| InChI | InChI=1S/C38H52O9/c1-15(2)18-20-26(40)23(25(39)17(5)6)28-21(27(20)46-31-22(18)29(41)34(7,8)32(43)36(31,11)12)19(16(3)4)24-30(42)35(9,10)33(44)37(13,14)38(24,45)47-28/h15-19,24,30,40,42,45H,1-14H3/t18-,19-,24-,30?,38+/m1/s1 |
| InChI Key | MHILVBADXLEDOF-HIYQAEMOSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C38H52O9 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.36113323 g/mol |
| Topological Polar Surface Area (TPSA) | 147.00 Ų |
| XlogP | 6.70 |
| (4aS,8R,14S,14aR)-1,4a,7-trihydroxy-2,2,4,4,10,10,12,12-octamethyl-6-(2-methylpropanoyl)-8,14-di(propan-2-yl)-1,8,14,14a-tetrahydrochromeno(2,3-a)xanthene-3,9,11-trione |
| (4aS,8R,14S,14aR)-1,4a,7-trihydroxy-2,2,4,4,10,10,12,12-octamethyl-6-(2-methylpropanoyl)-8,14-di(propan-2-yl)-1,8,14,14a-tetrahydrochromeno[2,3-a]xanthene-3,9,11-trione |
| RefChem:160502 |
| 126221-82-7 |
| CHEMBL444217 |
| SCHEMBL29621526 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.45% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.34% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.43% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.56% | 85.14% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.44% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.88% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.04% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.33% | 94.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.09% | 89.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.64% | 90.08% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.82% | 90.17% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.01% | 91.24% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.65% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.01% | 90.71% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.51% | 92.78% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.47% | 97.25% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.12% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Corymbia scabrida |
| PubChem | 44587063 |
| NPASS | NPC473509 |
| ChEMBL | CHEMBL444217 |
| LOTUS | LTS0250589 |
| wikiData | Q105163827 |