[(2S,3R,4R,5S,6R)-4,5-dihydroxy-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-5-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methoxy]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | 9b3532e7-e606-4ef9-b48f-648e167b86a3 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Anthocyanins > Anthocyanidin-5-O-glycosides |
IUPAC Name | [(2S,3R,4R,5S,6R)-4,5-dihydroxy-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-5-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methoxy]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C([O+]=C4C=C(C=C(C4=C3)OC5C(C(C(C(O5)CO)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)O)O)O)OC(=O)C=CC7=CC(=C(C=C7)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@@H]([C@@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C([O+]=C4C=C(C=C(C4=C3)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](O5)CO)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)O)O)O)OC(=O)C=CC7=CC(=C(C=C7)O)O |
InChI | InChI=1S/C42H46O24/c1-14-38(66-28(49)5-3-15-2-4-19(45)20(46)6-15)34(55)37(58)40(60-14)59-13-27-31(52)33(54)36(57)42(65-27)63-25-11-18-23(61-39(25)16-7-21(47)29(50)22(48)8-16)9-17(44)10-24(18)62-41-35(56)32(53)30(51)26(12-43)64-41/h2-11,14,26-27,30-38,40-43,51-58H,12-13H2,1H3,(H5-,44,45,46,47,48,49,50)/p+1/t14-,26-,27+,30+,31+,32-,33-,34+,35+,36+,37-,38-,40+,41+,42+/m0/s1 |
InChI Key | IKDOTTITLSOPAR-IGISAHJKSA-O |
Popularity | 0 references in papers |
Molecular Formula | C42H47O24+ |
Molecular Weight | 935.80 g/mol |
Exact Mass | 935.24572736 g/mol |
Topological Polar Surface Area (TPSA) | 386.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.89% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.36% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.01% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.54% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 95.75% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.74% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.48% | 96.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.97% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.27% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.10% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.19% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.10% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 89.61% | 98.95% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.45% | 83.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.06% | 97.09% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 84.85% | 80.78% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.56% | 90.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.06% | 91.71% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.92% | 89.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.91% | 95.50% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 82.70% | 97.31% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.98% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Petunia occidentalis |
PubChem | 163188837 |
LOTUS | LTS0185482 |
wikiData | Q105114314 |