5,15-Dihydroxy-2,6,12-trimethyl-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-7,17-dione
| Internal ID | 6150a3e1-5c7d-4ba1-bcfb-dedf1a6fb126 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | 5,15-dihydroxy-2,6,12-trimethyl-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-7,17-dione |
| SMILES (Canonical) | CC1C(=O)C23CCC4C5(CCC(C4(C2(CCC1(C3)O)C)OC5=O)O)C |
| SMILES (Isomeric) | CC1C(=O)C23CCC4C5(CCC(C4(C2(CCC1(C3)O)C)OC5=O)O)C |
| InChI | InChI=1S/C20H28O5/c1-11-14(22)18-7-4-12-16(2)6-5-13(21)20(12,25-15(16)23)17(18,3)8-9-19(11,24)10-18/h11-13,21,24H,4-10H2,1-3H3 |
| InChI Key | VRLSVXVVIDFQKV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.19367399 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 1.30 |
| There are no found synonyms. |
![2D Structure of 5,15-Dihydroxy-2,6,12-trimethyl-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-7,17-dione](https://plantaedb.com/storage/docs/compounds/2023/11/515-dihydroxy-2612-trimethyl-16-oxapentacyclo10321580111028octadecane-717-dione.jpg "2D Structure of 5,15-Dihydroxy-2,6,12-trimethyl-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-7,17-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.41% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.37% | 98.95% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.27% | 82.69% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 87.68% | 95.38% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.48% | 97.25% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.97% | 89.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 86.86% | 96.43% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.62% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.15% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.92% | 97.09% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.53% | 97.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.46% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.10% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.93% | 99.23% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.59% | 92.94% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.99% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Parinari sprucei |
| PubChem | 162924836 |
| LOTUS | LTS0113836 |
| wikiData | Q105291843 |