4-[[1-[(10-Benzyl-15,30-dihydroxy-24,31-dimethyl-2,9,12,19,22,26-hexaoxo-25-oxa-1,8,11,18,21-pentazatetracyclo[25.4.0.03,8.013,18]hentriacont-27-en-23-yl)amino]-1-oxo-3-phenylpropan-2-yl]-methylamino]-4-oxo-2-propan-2-ylbutanoic acid
Internal ID | d623eb27-21e3-483c-a6fe-52f72ca3d6d1 |
Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
IUPAC Name | 4-[[1-[(10-benzyl-15,30-dihydroxy-24,31-dimethyl-2,9,12,19,22,26-hexaoxo-25-oxa-1,8,11,18,21-pentazatetracyclo[25.4.0.03,8.013,18]hentriacont-27-en-23-yl)amino]-1-oxo-3-phenylpropan-2-yl]-methylamino]-4-oxo-2-propan-2-ylbutanoic acid |
SMILES (Canonical) | CC1C(CC=C2N1C(=O)C3CCCCN3C(=O)C(NC(=O)C4CC(CCN4C(=O)CNC(=O)C(C(OC2=O)C)NC(=O)C(CC5=CC=CC=C5)N(C)C(=O)CC(C(C)C)C(=O)O)O)CC6=CC=CC=C6)O |
SMILES (Isomeric) | CC1C(CC=C2N1C(=O)C3CCCCN3C(=O)C(NC(=O)C4CC(CCN4C(=O)CNC(=O)C(C(OC2=O)C)NC(=O)C(CC5=CC=CC=C5)N(C)C(=O)CC(C(C)C)C(=O)O)O)CC6=CC=CC=C6)O |
InChI | InChI=1S/C51H67N7O13/c1-29(2)35(50(68)69)27-42(61)55(5)39(25-33-16-10-7-11-17-33)45(63)54-44-31(4)71-51(70)38-19-20-41(60)30(3)58(38)49(67)37-18-12-13-22-57(37)48(66)36(24-32-14-8-6-9-15-32)53-46(64)40-26-34(59)21-23-56(40)43(62)28-52-47(44)65/h6-11,14-17,19,29-31,34-37,39-41,44,59-60H,12-13,18,20-28H2,1-5H3,(H,52,65)(H,53,64)(H,54,63)(H,68,69) |
InChI Key | HAEJOGZRLRGRCG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H67N7O13 |
Molecular Weight | 986.10 g/mol |
Exact Mass | 985.47968522 g/mol |
Topological Polar Surface Area (TPSA) | 273.00 Ų |
XlogP | 2.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.80% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.16% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.33% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.37% | 95.56% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.72% | 97.64% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.30% | 90.71% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 93.26% | 93.03% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.03% | 95.93% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.79% | 90.08% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.20% | 85.14% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 90.18% | 93.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.05% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.03% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.00% | 97.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.55% | 89.00% |
CHEMBL4801 | P29466 | Caspase-1 | 87.25% | 96.85% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.55% | 93.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.03% | 91.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.89% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.83% | 94.73% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.97% | 95.83% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.93% | 91.71% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 81.70% | 96.31% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.62% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.42% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica charantia |
PubChem | 162816509 |
LOTUS | LTS0123217 |
wikiData | Q105137077 |