(1,2-Dihydroxy-4,4,6a,6b,8a,11,11,12,14b-nonamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a-dodecahydropicen-3-yl) acetate
Internal ID | e6000343-dd32-4e6f-9f38-d7c4a52489b3 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1,2-dihydroxy-4,4,6a,6b,8a,11,11,12,14b-nonamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a-dodecahydropicen-3-yl) acetate |
SMILES (Canonical) | CC1C2C3=CC=C4C(C3(CCC2(CCC1(C)C)C)C)(CCC5C4(C(C(C(C5(C)C)OC(=O)C)O)O)C)C |
SMILES (Isomeric) | CC1C2C3=CC=C4C(C3(CCC2(CCC1(C)C)C)C)(CCC5C4(C(C(C(C5(C)C)OC(=O)C)O)O)C)C |
InChI | InChI=1S/C33H52O4/c1-19-24-21-11-12-23-32(9,31(21,8)18-17-30(24,7)16-15-28(19,3)4)14-13-22-29(5,6)27(37-20(2)34)25(35)26(36)33(22,23)10/h11-12,19,22,24-27,35-36H,13-18H2,1-10H3 |
InChI Key | AADOJZQDYHYGQE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H52O4 |
Molecular Weight | 512.80 g/mol |
Exact Mass | 512.38656014 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 7.70 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.96% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.27% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.85% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 90.09% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.57% | 97.25% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.94% | 96.95% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.90% | 97.21% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.55% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.45% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.96% | 92.94% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.90% | 82.69% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.97% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.56% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.25% | 91.07% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.12% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.42% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.24% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.05% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salvia kronenburgii |
PubChem | 163029374 |
LOTUS | LTS0197317 |
wikiData | Q104907850 |