5,13,16-Trihydroxy-8-(2-hydroxypropyl)-18-methyl-1,9-dioxacyclooctadeca-3,11-diene-2,10-dione
| Internal ID | 1ce05fad-a2a1-4189-a853-aadd954d3d91 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | 5,13,16-trihydroxy-8-(2-hydroxypropyl)-18-methyl-1,9-dioxacyclooctadeca-3,11-diene-2,10-dione |
| SMILES (Canonical) | CC1CC(CCC(C=CC(=O)OC(CCC(C=CC(=O)O1)O)CC(C)O)O)O |
| SMILES (Isomeric) | CC1CC(CCC(C=CC(=O)OC(CCC(C=CC(=O)O1)O)CC(C)O)O)O |
| InChI | InChI=1S/C20H32O8/c1-13(21)11-18-8-5-16(23)6-9-19(25)27-14(2)12-17(24)4-3-15(22)7-10-20(26)28-18/h6-7,9-10,13-18,21-24H,3-5,8,11-12H2,1-2H3 |
| InChI Key | NXGWQHYMRZJAGZ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.20971797 g/mol |
| Topological Polar Surface Area (TPSA) | 134.00 Ų |
| XlogP | 0.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.99% | 85.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.90% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.18% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.79% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.75% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.98% | 90.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.91% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.29% | 95.56% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 85.99% | 83.82% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.50% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.93% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.85% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.72% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.73% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163066079 |
| LOTUS | LTS0061522 |
| wikiData | Q104180112 |