5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol
| Internal ID | 12fbcf59-7381-436f-8525-ac767e2fbb32 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol |
| SMILES (Canonical) | CC1=C2C=CN=CC2=C(C3=C1NC4=C3C=C(C=C4)O)C |
| SMILES (Isomeric) | CC1=C2C=CN=CC2=C(C3=C1NC4=C3C=C(C=C4)O)C |
| InChI | InChI=1S/C17H14N2O/c1-9-14-8-18-6-5-12(14)10(2)17-16(9)13-7-11(20)3-4-15(13)19-17/h3-8,19-20H,1-2H3 |
| InChI Key | QZTWUDDGLIDXSE-UHFFFAOYSA-N |
| Popularity | 180 references in papers |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.110613074 g/mol |
| Topological Polar Surface Area (TPSA) | 48.90 Ų |
| XlogP | 4.40 |
| Atomic LogP (AlogP) | 4.19 |
| H-Bond Acceptor | 2 |
| H-Bond Donor | 2 |
| Rotatable Bonds | 0 |
| 5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol |
| 51131-85-2 |
| 9-Hydroxyellipticin |
| Hydroxyellipticine |
| 9-Hydroxyellipticin free base |
| IGIG 929 |
| ELLIPTICINE, 9-HYDROXY- |
| NSC 210717 |
| 6H-Pyrido(4,3-b)carbazol-9-ol, 5,11-dimethyl- |
| 9G4A3ET6XG |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9971 | 99.71% |
| Caco-2 | - | 0.7489 | 74.89% |
| Blood Brain Barrier | + | 0.6379 | 63.79% |
| Human oral bioavailability | - | 0.5429 | 54.29% |
| Subcellular localzation | Mitochondria | 0.8279 | 82.79% |
| OATP2B1 inhibitior | - | 0.8527 | 85.27% |
| OATP1B1 inhibitior | + | 0.8823 | 88.23% |
| OATP1B3 inhibitior | + | 0.9466 | 94.66% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.5973 | 59.73% |
| P-glycoprotein inhibitior | - | 0.9260 | 92.60% |
| P-glycoprotein substrate | - | 0.5271 | 52.71% |
| CYP3A4 substrate | - | 0.5536 | 55.36% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7973 | 79.73% |
| CYP3A4 inhibition | + | 0.5690 | 56.90% |
| CYP2C9 inhibition | - | 0.6830 | 68.30% |
| CYP2C19 inhibition | - | 0.7959 | 79.59% |
| CYP2D6 inhibition | + | 0.7994 | 79.94% |
| CYP1A2 inhibition | + | 0.9027 | 90.27% |
| CYP2C8 inhibition | + | 0.8506 | 85.06% |
| CYP inhibitory promiscuity | + | 0.5694 | 56.94% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.9454 | 94.54% |
| Carcinogenicity (trinary) | Non-required | 0.5162 | 51.62% |
| Eye corrosion | - | 0.9942 | 99.42% |
| Eye irritation | - | 0.6053 | 60.53% |
| Skin irritation | - | 0.8260 | 82.60% |
| Skin corrosion | - | 0.9627 | 96.27% |
| Ames mutagenesis | + | 0.7600 | 76.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5911 | 59.11% |
| Micronuclear | + | 0.7900 | 79.00% |
| Hepatotoxicity | + | 0.5750 | 57.50% |
| skin sensitisation | - | 0.8812 | 88.12% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.7556 | 75.56% |
| Mitochondrial toxicity | - | 0.7750 | 77.50% |
| Nephrotoxicity | - | 0.8331 | 83.31% |
| Acute Oral Toxicity (c) | III | 0.4559 | 45.59% |
| Estrogen receptor binding | + | 0.8610 | 86.10% |
| Androgen receptor binding | + | 0.7347 | 73.47% |
| Thyroid receptor binding | + | 0.7649 | 76.49% |
| Glucocorticoid receptor binding | + | 0.9088 | 90.88% |
| Aromatase binding | + | 0.8845 | 88.45% |
| PPAR gamma | + | 0.7565 | 75.65% |
| Honey bee toxicity | - | 0.9403 | 94.03% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | + | 0.6200 | 62.00% |
| Fish aquatic toxicity | - | 0.6852 | 68.52% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL2742 | P22607 | Fibroblast growth factor receptor 3 |
400 nM |
IC50 |
via Super-PRED
|
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha |
600 nM |
IC50 |
via Super-PRED
|
| CHEMBL1936 | P10721 | Stem cell growth factor receptor |
400 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 99.05% | 93.24% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.47% | 94.45% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 95.18% | 98.59% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 95.10% | 93.10% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 93.04% | 95.56% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 92.84% | 91.79% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.74% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.10% | 85.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.25% | 98.75% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 88.69% | 93.65% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 88.19% | 98.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.05% | 98.95% |
| CHEMBL2424504 | P29375 | Lysine-specific demethylase 5A | 87.32% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.14% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.91% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.58% | 91.49% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.11% | 97.36% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 85.07% | 85.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.77% | 94.00% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.50% | 97.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.49% | 91.71% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 84.11% | 99.09% |
| CHEMBL5543 | Q9Y463 | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | 84.06% | 94.70% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.85% | 97.79% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 83.21% | 85.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.84% | 83.82% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 81.89% | 88.56% |
| CHEMBL3553 | P29597 | Tyrosine-protein kinase TYK2 | 81.53% | 97.09% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.35% | 85.30% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.76% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ochrosia elliptica |
| PubChem | 91643 |
| LOTUS | LTS0105414 |
| wikiData | Q27160170 |