5,11-Dimethyl-4,6-dihydro-3H-pyrido[4,3-b]carbazole
| Internal ID | b1d38e0c-72bb-42ac-967c-bc85c075c936 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 5,11-dimethyl-4,6-dihydro-3H-pyrido[4,3-b]carbazole |
| SMILES (Canonical) | CC1=C2CCN=CC2=C(C3=C1NC4=CC=CC=C43)C |
| SMILES (Isomeric) | CC1=C2CCN=CC2=C(C3=C1NC4=CC=CC=C43)C |
| InChI | InChI=1S/C17H16N2/c1-10-14-9-18-8-7-12(14)11(2)17-16(10)13-5-3-4-6-15(13)19-17/h3-6,9,19H,7-8H2,1-2H3 |
| InChI Key | CKERKSAMDZOBHU-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.131348519 g/mol |
| Topological Polar Surface Area (TPSA) | 28.20 Ų |
| XlogP | 3.50 |
| 5,11-Dimethyl-4,6-dihydro-3H-pyrido[4,3-b]carbazole |
| CHEMBL3290610 |
| DTXSID10726901 |
![2D Structure of 5,11-Dimethyl-4,6-dihydro-3H-pyrido[4,3-b]carbazole](https://plantaedb.com/storage/docs/compounds/2023/11/511-dimethyl-46-dihydro-3h-pyrido43-bcarbazole.jpg "2D Structure of 5,11-Dimethyl-4,6-dihydro-3H-pyrido[4,3-b]carbazole")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL240 | Q12809 | HERG | 97.41% | 89.76% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.79% | 91.49% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.97% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.83% | 95.56% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 92.37% | 88.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.59% | 91.11% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 88.90% | 92.98% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.42% | 94.45% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.32% | 93.65% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 85.48% | 96.39% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.57% | 96.09% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 84.44% | 85.49% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.43% | 94.08% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 83.99% | 93.81% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 83.88% | 97.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.61% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.48% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.62% | 98.75% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.57% | 96.67% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.16% | 98.59% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.75% | 91.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.65% | 90.08% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 81.62% | 85.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.05% | 99.23% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 80.61% | 95.70% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aspidosperma subincanum |
| Ochrosia balansae |
| PubChem | 57494722 |
| LOTUS | LTS0077128 |
| wikiData | Q82667837 |