[6-[(3,6-Dimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[8,7-b]furan-9-yl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate
Internal ID | ef51ba67-9441-4b71-9f81-934229eeebeb |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | [6-[(3,6-dimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[8,7-b]furan-9-yl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate |
SMILES (Canonical) | CC1C2CCC(=C3C(C2OC1=O)C(=CC3=O)COC4C(C(C(C(O4)COC(=O)CC5=CC=C(C=C5)O)O)O)O)C |
SMILES (Isomeric) | CC1C2CCC(=C3C(C2OC1=O)C(=CC3=O)COC4C(C(C(C(O4)COC(=O)CC5=CC=C(C=C5)O)O)O)O)C |
InChI | InChI=1S/C29H34O11/c1-13-3-8-18-14(2)28(36)40-27(18)23-16(10-19(31)22(13)23)11-38-29-26(35)25(34)24(33)20(39-29)12-37-21(32)9-15-4-6-17(30)7-5-15/h4-7,10,14,18,20,23-27,29-30,33-35H,3,8-9,11-12H2,1-2H3 |
InChI Key | GAMSURTVDXDTRP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H34O11 |
Molecular Weight | 558.60 g/mol |
Exact Mass | 558.21011190 g/mol |
Topological Polar Surface Area (TPSA) | 169.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of [6-[(3,6-Dimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[8,7-b]furan-9-yl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate 2D Structure of [6-[(3,6-Dimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[8,7-b]furan-9-yl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 2-(4-hydroxyphenyl)acetate](https://plantaedb.com/storage/docs/compounds/2023/11/51003020-881e-11ee-a4ad-afecf0a06b8d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.76% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.74% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.57% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.24% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.56% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.27% | 99.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.26% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.58% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.32% | 95.89% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.34% | 94.80% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.86% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.86% | 95.56% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.06% | 83.82% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.03% | 92.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.41% | 86.33% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 83.38% | 85.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.31% | 89.00% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.58% | 90.08% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.45% | 94.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.44% | 97.25% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.41% | 96.61% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.63% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.51% | 94.73% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.46% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Crepidiastrum lanceolatum |
PubChem | 73804568 |
LOTUS | LTS0144161 |
wikiData | Q105005480 |