(5,10-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl) acetate
| Internal ID | c0561a50-49df-4bef-80f9-7c55d22edff5 |
| Taxonomy | Phenylpropanoids and polyketides > Isochromanequinones > Benzoisochromanequinones |
| IUPAC Name | (5,10-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl) acetate |
| SMILES (Canonical) | CC(=O)OC1CC2=C(CO1)C(=O)C3=CC=CC=C3C2=O |
| SMILES (Isomeric) | CC(=O)OC1CC2=C(CO1)C(=O)C3=CC=CC=C3C2=O |
| InChI | InChI=1S/C15H12O5/c1-8(16)20-13-6-11-12(7-19-13)15(18)10-5-3-2-4-9(10)14(11)17/h2-5,13H,6-7H2,1H3 |
| InChI Key | VFHUZKILLBTINK-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 69.70 Ų |
| XlogP | 1.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.07% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.05% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.36% | 99.23% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.95% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.68% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.47% | 86.33% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.50% | 82.69% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.94% | 91.11% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.71% | 96.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.01% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dolichopentas longiflora |
| PubChem | 13887386 |
| LOTUS | LTS0100166 |
| wikiData | Q105285295 |