5,10-Dimethoxy-4-methyl-1H-benzo[g]quinolin-2-one
| Internal ID | 3c6517bd-21f3-49d6-879c-fb0776df8ea5 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines |
| IUPAC Name | 5,10-dimethoxy-4-methyl-1H-benzo[g]quinolin-2-one |
| SMILES (Canonical) | CC1=CC(=O)NC2=C(C3=CC=CC=C3C(=C12)OC)OC |
| SMILES (Isomeric) | CC1=CC(=O)NC2=C(C3=CC=CC=C3C(=C12)OC)OC |
| InChI | InChI=1S/C16H15NO3/c1-9-8-12(18)17-14-13(9)15(19-2)10-6-4-5-7-11(10)16(14)20-3/h4-8H,1-3H3,(H,17,18) |
| InChI Key | UAOWKPPYWUJTPK-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.10519334 g/mol |
| Topological Polar Surface Area (TPSA) | 47.60 Ų |
| XlogP | 2.40 |
| 5,10-Dimethoxy-4-methyl-1H-benzo[g]quinolin-2-one |
| 1-Aza-9,10-dimethoxy-4-methyl-2-oxo-1,2-dihydroanthracene |
![2D Structure of 5,10-Dimethoxy-4-methyl-1H-benzo[g]quinolin-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/510-dimethoxy-4-methyl-1h-benzogquinolin-2-one.jpg "2D Structure of 5,10-Dimethoxy-4-methyl-1H-benzo[g]quinolin-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.93% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.64% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.31% | 93.99% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 93.24% | 92.98% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.51% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.43% | 94.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.30% | 94.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.65% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.55% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.18% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.69% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.84% | 94.73% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.87% | 93.65% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.17% | 94.80% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 83.94% | 92.67% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.05% | 93.31% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 80.94% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Polyalthia suberosa |
| Trivalvaria costata |
| PubChem | 489939 |
| LOTUS | LTS0124445 |
| wikiData | Q105268958 |