5,10-Dihydroxy-4-methoxyanthra[1,2-c]furan-3,6,11(1H)-trione
| Internal ID | dc9ac977-c099-4ea3-8b76-b0d159640ce6 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
| IUPAC Name | 5,10-dihydroxy-4-methoxy-1H-naphtho[3,2-e][2]benzofuran-3,6,11-trione |
| SMILES (Canonical) | COC1=C2C(=C3C(=C1O)C(=O)C4=C(C3=O)C(=CC=C4)O)COC2=O |
| SMILES (Isomeric) | COC1=C2C(=C3C(=C1O)C(=O)C4=C(C3=O)C(=CC=C4)O)COC2=O |
| InChI | InChI=1S/C17H10O7/c1-23-16-11-7(5-24-17(11)22)10-12(15(16)21)13(19)6-3-2-4-8(18)9(6)14(10)20/h2-4,18,21H,5H2,1H3 |
| InChI Key | UHKMGJMITSJFRA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H10O7 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.04265265 g/mol |
| Topological Polar Surface Area (TPSA) | 110.00 Ų |
| XlogP | 2.70 |
| 5,10-Dihydroxy-4-methoxyanthra[1,2-c]furan-3,6,11(1H)-trione |
| 145040-48-8 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.68% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.87% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.53% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.37% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.22% | 99.23% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 91.95% | 98.21% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.22% | 99.15% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.47% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.76% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.56% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.60% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.39% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.78% | 94.73% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.22% | 96.67% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 81.66% | 91.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Berchemia discolor |
| PubChem | 101634662 |
| LOTUS | LTS0012903 |
| wikiData | Q105272937 |