[(1R,5R,6S,8R,9R,11R)-9-(1-hydroxyethenoxy)-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl] 2-methylpropanoate
| Internal ID | 5a6e9d63-aef1-4aca-a8fd-a2b0e1f64d43 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Triquinane sesquiterpenoids > Angular triquinanes |
| IUPAC Name | [(1R,5R,6S,8R,9R,11R)-9-(1-hydroxyethenoxy)-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl] 2-methylpropanoate |
| SMILES (Canonical) | CC1CC(C2C13C=CC(=O)C3(C(C2(C)C)OC(=O)C(C)C)C)OC(=C)O |
| SMILES (Isomeric) | C[C@@H]1C[C@H]([C@@H]2[C@]13C=CC(=O)[C@]3([C@H](C2(C)C)OC(=O)C(C)C)C)OC(=C)O |
| InChI | InChI=1S/C21H30O5/c1-11(2)17(24)26-18-19(5,6)16-14(25-13(4)22)10-12(3)21(16)9-8-15(23)20(18,21)7/h8-9,11-12,14,16,18,22H,4,10H2,1-3,5-7H3/t12-,14-,16+,18+,20+,21+/m1/s1 |
| InChI Key | OMCNUAZNXLCETR-LWTGDQKNSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.20932405 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
![2D Structure of [(1R,5R,6S,8R,9R,11R)-9-(1-hydroxyethenoxy)-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl] 2-methylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/50a1bff0-84ce-11ee-93cf-718b14708ff8.jpg "2D Structure of [(1R,5R,6S,8R,9R,11R)-9-(1-hydroxyethenoxy)-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl] 2-methylpropanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.44% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.30% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.82% | 91.49% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.38% | 91.19% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.95% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.27% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.97% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.14% | 94.45% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.92% | 96.47% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.61% | 97.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.04% | 96.77% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.42% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.22% | 86.33% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 80.06% | 94.97% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cineraria geifolia |
| PubChem | 163105390 |
| LOTUS | LTS0081793 |
| wikiData | Q105194277 |