3-[[(2R,3S,4S,5R,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]-3,4-dihydroxy-5-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]methoxy]-3-oxopropanoic acid
Internal ID | 9f7ad09e-302c-4aa6-bb97-d702c2f2978d |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
IUPAC Name | 3-[[(2R,3S,4S,5R,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]-3,4-dihydroxy-5-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]methoxy]-3-oxopropanoic acid |
SMILES (Canonical) | C1C(C(C(C(O1)OC2C(C(C(OC2C3=C(C=C(C4=C3OC(=CC4=O)C5=CC=C(C=C5)O)O)O)COC(=O)CC(=O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@H]([C@H]([C@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2C3=C(C=C(C4=C3OC(=CC4=O)C5=CC=C(C=C5)O)O)O)COC(=O)CC(=O)O)O)O)O)O)O |
InChI | InChI=1S/C29H30O17/c30-11-3-1-10(2-4-11)16-6-14(33)20-12(31)5-13(32)21(26(20)44-16)27-28(46-29-25(41)22(38)15(34)8-43-29)24(40)23(39)17(45-27)9-42-19(37)7-18(35)36/h1-6,15,17,22-25,27-32,34,38-41H,7-9H2,(H,35,36)/t15-,17-,22-,23-,24+,25-,27+,28-,29-/m1/s1 |
InChI Key | QCKLWMZDBAKXMG-DLZIFNNKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H30O17 |
Molecular Weight | 650.50 g/mol |
Exact Mass | 650.14829948 g/mol |
Topological Polar Surface Area (TPSA) | 279.00 Ų |
XlogP | -1.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.59% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.33% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.14% | 89.00% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 92.79% | 89.23% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.50% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.71% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.52% | 85.14% |
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 89.67% | 91.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.71% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.78% | 86.33% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 86.71% | 80.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.22% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.15% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.02% | 91.49% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.79% | 95.83% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.70% | 90.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.13% | 91.19% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.85% | 95.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.26% | 92.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.18% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.22% | 99.23% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.86% | 86.92% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.37% | 95.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Beta vulgaris |
PubChem | 163042692 |
LOTUS | LTS0125328 |
wikiData | Q105218265 |