(1R,2S,4S,8R,9S,12S,13S,16S,18S)-16-[(2R,3R,4R,5R,6R)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7,9,13-trimethyl-6-[(3S)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-6-en-10-one
Internal ID | 1452285a-cccb-442d-ae32-05d54479d07f |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (1R,2S,4S,8R,9S,12S,13S,16S,18S)-16-[(2R,3R,4R,5R,6R)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7,9,13-trimethyl-6-[(3S)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-6-en-10-one |
SMILES (Canonical) | CC1=C(OC2C1C3(C(C2)C4CCC5CC(CCC5(C4CC3=O)C)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)CO)O)O)O)O)O)C)CCC(C)COC9C(C(C(C(O9)CO)O)O)O |
SMILES (Isomeric) | CC1=C(O[C@@H]2[C@H]1[C@@]3([C@@H](C2)[C@@H]4CC[C@H]5C[C@H](CC[C@@]5([C@H]4CC3=O)C)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O[C@H]8[C@@H]([C@H]([C@H]([C@H](O8)CO)O)O)O)O)O)C)CC[C@H](C)CO[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O |
InChI | InChI=1S/C51H82O24/c1-19(18-67-46-41(64)37(60)34(57)28(14-52)70-46)5-8-26-20(2)33-27(69-26)12-25-23-7-6-21-11-22(9-10-50(21,3)24(23)13-32(56)51(25,33)4)68-47-43(66)40(63)44(31(17-55)73-47)74-49-45(39(62)36(59)30(16-54)72-49)75-48-42(65)38(61)35(58)29(15-53)71-48/h19,21-25,27-31,33-49,52-55,57-66H,5-18H2,1-4H3/t19-,21-,22-,23+,24-,25-,27-,28+,29+,30+,31+,33-,34+,35-,36+,37-,38-,39-,40+,41+,42+,43+,44-,45+,46+,47+,48-,49-,50-,51+/m0/s1 |
InChI Key | TVRRDUXJKROMDX-NZXZYLLTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H82O24 |
Molecular Weight | 1079.20 g/mol |
Exact Mass | 1078.51960348 g/mol |
Topological Polar Surface Area (TPSA) | 383.00 Ų |
XlogP | -2.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.77% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.47% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.20% | 97.09% |
CHEMBL220 | P22303 | Acetylcholinesterase | 92.39% | 94.45% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.04% | 94.45% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 89.54% | 93.18% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.54% | 97.79% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.53% | 94.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.65% | 97.25% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.87% | 94.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 87.78% | 92.98% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.71% | 96.47% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.43% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.14% | 100.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.66% | 96.21% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.39% | 90.71% |
CHEMBL237 | P41145 | Kappa opioid receptor | 84.78% | 98.10% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.55% | 95.56% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.81% | 97.29% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.67% | 92.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.66% | 96.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.10% | 96.38% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.81% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.22% | 98.95% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.11% | 96.37% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.10% | 99.23% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.09% | 93.56% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 80.52% | 96.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.22% | 95.89% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.13% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tribulus terrestris |
PubChem | 163029985 |
LOTUS | LTS0156922 |
wikiData | Q105265519 |