(1S,4aS,4bS,7R,8R,10aS)-8-acetyloxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carboxylic acid
| Internal ID | 497de764-b39b-46aa-bc18-61bf4eee0fac |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid acids > 4-carboxy steroids |
| IUPAC Name | (1S,4aS,4bS,7R,8R,10aS)-8-acetyloxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carboxylic acid |
| SMILES (Canonical) | CC(C)C1CCC2C(=CCC3C2(CCCC3(C)C(=O)O)C)C1OC(=O)C |
| SMILES (Isomeric) | CC(C)[C@H]1CC[C@@H]2C(=CC[C@H]3[C@]2(CCC[C@]3(C)C(=O)O)C)[C@@H]1OC(=O)C |
| InChI | InChI=1S/C22H34O4/c1-13(2)15-7-9-17-16(19(15)26-14(3)23)8-10-18-21(17,4)11-6-12-22(18,5)20(24)25/h8,13,15,17-19H,6-7,9-12H2,1-5H3,(H,24,25)/t15-,17-,18+,19-,21+,22+/m1/s1 |
| InChI Key | QSFKOXOLMLLFAI-MSXUYQLKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.24570956 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 4.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.32% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.51% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.77% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.11% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.16% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.93% | 91.19% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.44% | 94.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.31% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.13% | 95.56% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 87.03% | 94.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.81% | 93.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.24% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.17% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aeollanthus buchnerianus |
| PubChem | 162892935 |
| LOTUS | LTS0125051 |
| wikiData | Q105226928 |