7-hydroxy-6-methylfuro(3,4-c)pyridin-3(1H)-one
| Internal ID | 4aa3c556-2989-4936-bd55-69d5ebce9ab2 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyridinecarboxylic acids and derivatives > Pyridinecarboxylic acids |
| IUPAC Name | 7-hydroxy-6-methyl-1H-furo[3,4-c]pyridin-3-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C8H7NO3/c1-4-7(10)6-3-12-8(11)5(6)2-9-4/h2,10H,3H2,1H3 |
| InChI Key | PPAXBSPBIWBREI-UHFFFAOYSA-N |
| Popularity | 10 references in papers |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.042593085 g/mol |
| Topological Polar Surface Area (TPSA) | 59.40 Ų |
| XlogP | 0.30 |
| Pyracin-5 |
| .alpha.-Pyracin |
| 5-Pyridoxic acid lactone |
| 4543-56-0 |
| 7-Hydroxy-6-methylfuro[3,4-c]pyridin-3(1H)-one |
| Pyridoxic acid .gamma.-lactone |
| Pyridoxic acid, .gamma.-lactone |
| 7-hydroxy-6-methyl-1H-furo[3,4-c]pyridin-3-one |
| NSC15983 |
| NSC 15983 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.56% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.47% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.13% | 99.23% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 89.13% | 98.21% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.83% | 94.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.53% | 93.65% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.42% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.75% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.36% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.82% | 89.00% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 83.63% | 81.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.02% | 90.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.30% | 85.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.00% | 98.75% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.66% | 96.21% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.08% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 78300 |
| LOTUS | LTS0191955 |
| wikiData | Q27105557 |