5-O-Methyl-d-gluconic acid dimethylamide
| Internal ID | 561347d8-99ab-4c6e-a4c9-641c6fce0e3f |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | 2,3,4,6-tetrahydroxy-5-methoxy-N,N-dimethylhexanamide |
| SMILES (Canonical) | CN(C)C(=O)C(C(C(C(CO)OC)O)O)O |
| SMILES (Isomeric) | CN(C)C(=O)C(C(C(C(CO)OC)O)O)O |
| InChI | InChI=1S/C9H19NO6/c1-10(2)9(15)8(14)7(13)6(12)5(4-11)16-3/h5-8,11-14H,4H2,1-3H3 |
| InChI Key | NEKGNGUPHCHTGI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C9H19NO6 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.12123733 g/mol |
| Topological Polar Surface Area (TPSA) | 111.00 Ų |
| XlogP | -2.90 |
| NEKGNGUPHCHTGI-UHFFFAOYSA-N |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.02% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.16% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.45% | 99.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.15% | 91.19% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.87% | 94.33% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.79% | 98.75% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.40% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 542382 |
| LOTUS | LTS0089194 |
| wikiData | Q105177993 |