5-Methylflavasperone
Internal ID | c9188534-a1b5-4cfe-b3b7-cdafd08a79fb |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans > Naphthopyranones |
IUPAC Name | 5,8,10-trimethoxy-2-methylbenzo[h]chromen-4-one |
SMILES (Canonical) | CC1=CC(=O)C2=C(O1)C3=C(C=C(C=C3C=C2OC)OC)OC |
SMILES (Isomeric) | CC1=CC(=O)C2=C(O1)C3=C(C=C(C=C3C=C2OC)OC)OC |
InChI | InChI=1S/C17H16O5/c1-9-5-12(18)16-13(20-3)7-10-6-11(19-2)8-14(21-4)15(10)17(16)22-9/h5-8H,1-4H3 |
InChI Key | XIPRKZKXZRMYTO-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C17H16O5 |
Molecular Weight | 300.30 g/mol |
Exact Mass | 300.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 54.00 Ų |
XlogP | 3.10 |
CHEMBL505266 |
5,8,10-trimethoxy-2-methylbenzo[h]chromen-4-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.43% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.34% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.95% | 93.99% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.20% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.91% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.86% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.22% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.13% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.04% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.61% | 90.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.32% | 94.42% |
CHEMBL2581 | P07339 | Cathepsin D | 80.30% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Guiera senegalensis |
PubChem | 10780552 |
LOTUS | LTS0124564 |
wikiData | Q105328662 |