5-methyl-5H-[1,3]dioxolo[4,5-b]acridin-10-one
| Internal ID | 475fc8f5-33f6-43ea-840f-27a1f4a61d46 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 5-methyl-[1,3]dioxolo[4,5-b]acridin-10-one |
| SMILES (Canonical) | CN1C2=CC=CC=C2C(=O)C3=CC4=C(C=C31)OCO4 |
| SMILES (Isomeric) | CN1C2=CC=CC=C2C(=O)C3=CC4=C(C=C31)OCO4 |
| InChI | InChI=1S/C15H11NO3/c1-16-11-5-3-2-4-9(11)15(17)10-6-13-14(7-12(10)16)19-8-18-13/h2-7H,8H2,1H3 |
| InChI Key | LBBYONXYNHDOFP-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 38.80 Ų |
| XlogP | 2.90 |
| 5-methyl[1,3]dioxolo[4,5-b]acridin-10(5H)-one |
![2D Structure of 5-methyl-5H-[1,3]dioxolo[4,5-b]acridin-10-one](https://plantaedb.com/storage/docs/compounds/2023/11/5-methyl-5h-13dioxolo45-bacridin-10-one.jpg "2D Structure of 5-methyl-5H-[1,3]dioxolo[4,5-b]acridin-10-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.35% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.76% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.36% | 96.77% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.64% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.34% | 89.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.21% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.09% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.07% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.52% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.77% | 99.23% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.23% | 92.62% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.08% | 93.65% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.86% | 98.59% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 82.74% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.10% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.01% | 90.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.88% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citropsis articulata |
| PubChem | 14481984 |
| LOTUS | LTS0128953 |
| wikiData | Q105149160 |