[5-methyl-2-[(2S)-2-[[(E)-3-phenylprop-2-enoyl]oxymethyl]oxiran-2-yl]phenyl] 2-methylpropanoate
Internal ID | 75bebfc2-071c-41d1-b758-ee789d826e1f |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters |
IUPAC Name | [5-methyl-2-[(2S)-2-[[(E)-3-phenylprop-2-enoyl]oxymethyl]oxiran-2-yl]phenyl] 2-methylpropanoate |
SMILES (Canonical) | CC1=CC(=C(C=C1)C2(CO2)COC(=O)C=CC3=CC=CC=C3)OC(=O)C(C)C |
SMILES (Isomeric) | CC1=CC(=C(C=C1)[C@]2(CO2)COC(=O)/C=C/C3=CC=CC=C3)OC(=O)C(C)C |
InChI | InChI=1S/C23H24O5/c1-16(2)22(25)28-20-13-17(3)9-11-19(20)23(15-27-23)14-26-21(24)12-10-18-7-5-4-6-8-18/h4-13,16H,14-15H2,1-3H3/b12-10+/t23-/m1/s1 |
InChI Key | UZOYGCFMXOUXPT-JBOJMBJVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H24O5 |
Molecular Weight | 380.40 g/mol |
Exact Mass | 380.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 65.10 Ų |
XlogP | 4.30 |
There are no found synonyms. |
![2D Structure of [5-methyl-2-[(2S)-2-[[(E)-3-phenylprop-2-enoyl]oxymethyl]oxiran-2-yl]phenyl] 2-methylpropanoate 2D Structure of [5-methyl-2-[(2S)-2-[[(E)-3-phenylprop-2-enoyl]oxymethyl]oxiran-2-yl]phenyl] 2-methylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/5-methyl-2-2s-2-e-3-phenylprop-2-enoyloxymethyloxiran-2-ylphenyl-2-methylpropanoate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.45% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.60% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.86% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.58% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.00% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.94% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.18% | 94.73% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.10% | 94.62% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 91.84% | 96.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.97% | 95.50% |
CHEMBL5028 | O14672 | ADAM10 | 87.66% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.14% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.91% | 99.17% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.22% | 89.62% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.18% | 97.21% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.94% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ageratina anisochroma |
PubChem | 163187160 |
LOTUS | LTS0038767 |
wikiData | Q105282378 |