5-Methyl-1,3-benzodioxole-4,7-dione
| Internal ID | 85634cc5-871a-4870-bcff-2a19374e8e31 |
| Taxonomy | Organoheterocyclic compounds > Dioxoles > 1,3-dioxoles |
| IUPAC Name | 5-methyl-1,3-benzodioxole-4,7-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C8H6O4/c1-4-2-5(9)7-8(6(4)10)12-3-11-7/h2H,3H2,1H3 |
| InChI Key | YOELFSHEOGQGPJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 166.02660867 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 0.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.07% | 96.77% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.95% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.62% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.23% | 94.73% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.21% | 94.80% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 85.68% | 86.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.85% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.63% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.34% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73507565 |
| LOTUS | LTS0166515 |
| wikiData | Q105351260 |