5-Methoxyindole-2-carboxylic acid
| Internal ID | 8a7a8389-5075-4387-8eed-755fe4ae12c3 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolecarboxylic acids and derivatives |
| IUPAC Name | 5-methoxy-1H-indole-2-carboxylic acid |
| SMILES (Canonical) | COC1=CC2=C(C=C1)NC(=C2)C(=O)O |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)NC(=C2)C(=O)O |
| InChI | InChI=1S/C10H9NO3/c1-14-7-2-3-8-6(4-7)5-9(11-8)10(12)13/h2-5,11H,1H3,(H,12,13) |
| InChI Key | YEBJVSLNUMZXRJ-UHFFFAOYSA-N |
| Popularity | 48 references in papers |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.058243149 g/mol |
| Topological Polar Surface Area (TPSA) | 62.30 Ų |
| XlogP | 2.30 |
| 4382-54-1 |
| 5-Methoxy-1H-indole-2-carboxylic acid |
| 1H-Indole-2-carboxylic acid, 5-methoxy- |
| 5-Methoxy-2-indolecarboxylic acid |
| MFCD00005614 |
| INDOLE-2-CARBOXYLIC ACID, 5-METHOXY- |
| NSC 30927 |
| Acide methoxy-5 indole carboxylique-2 |
| AFK8L54HA2 |
| NSC-30927 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.50% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.51% | 96.09% |
| CHEMBL2568 | P06737 | Liver glycogen phosphorylase | 92.22% | 96.92% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.39% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.13% | 95.56% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.70% | 91.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.28% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.93% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.83% | 98.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.01% | 96.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.75% | 93.31% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.63% | 98.95% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.61% | 94.08% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.52% | 86.33% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 80.42% | 93.24% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.40% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Solanum lycopersicum |
| PubChem | 20401 |
| LOTUS | LTS0210556 |
| wikiData | Q72490085 |