5"-Methoxyhexahydrocurcumin
Internal ID | d7f19c11-9f7c-44f4-bcb9-143061dade2c |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids > Curcuminoids |
IUPAC Name | 5-hydroxy-7-(4-hydroxy-3,5-dimethoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)heptan-3-one |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)CCC(CC(=O)CCC2=CC(=C(C=C2)O)OC)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)CCC(CC(=O)CCC2=CC(=C(C=C2)O)OC)O |
InChI | InChI=1S/C22H28O7/c1-27-19-10-14(6-9-18(19)25)4-7-16(23)13-17(24)8-5-15-11-20(28-2)22(26)21(12-15)29-3/h6,9-12,17,24-26H,4-5,7-8,13H2,1-3H3 |
InChI Key | CAQJIHGGUCTKHW-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C22H28O7 |
Molecular Weight | 404.50 g/mol |
Exact Mass | 404.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 105.00 Ų |
XlogP | 2.70 |
5"-Methoxyhexahydrocurcumin |
5-Hydroxy-7-(4-hydroxy-3,5-dimethoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)heptan-3-one |
3-Heptanone, 5-hydroxy-7-(4-hydroxy-3,5-dimethoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)- |
5'-Methoxyhexahydrocurcumin |
starbld0000791 |
5""""""""-Methoxyhexahydrocurcumin |
AKOS040762824 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.06% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.45% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.34% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.64% | 99.17% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.82% | 95.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.42% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.08% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.21% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 88.90% | 98.75% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 86.96% | 90.20% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.84% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.56% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.52% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.35% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.93% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.60% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zingiber officinale |
PubChem | 15118818 |
LOTUS | LTS0059019 |
wikiData | Q104951756 |