5-methoxycochlione B
| Internal ID | 37365a92-5800-432d-8778-0b7911f15a27 |
| Taxonomy | Organoheterocyclic compounds > Pyrans > Pyranones and derivatives > Dihydropyranones |
| IUPAC Name | (1aS,2R,3S,7bS)-2-hydroxy-3-methoxy-6,6-dimethyl-2,3,5,7b-tetrahydro-1aH-oxireno[2,3-h]chromen-4-one |
| SMILES (Canonical) | CC1(CC(=O)C2=C(O1)C3C(O3)C(C2OC)O)C |
| SMILES (Isomeric) | CC1(CC(=O)C2=C(O1)[C@@H]3[C@@H](O3)[C@@H]([C@H]2OC)O)C |
| InChI | InChI=1S/C12H16O5/c1-12(2)4-5(13)6-8(15-3)7(14)10-11(16-10)9(6)17-12/h7-8,10-11,14H,4H2,1-3H3/t7-,8+,10+,11-/m1/s1 |
| InChI Key | VHCLDFUKOVJFAN-YKDSUIRESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 68.30 Ų |
| XlogP | -1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.37% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.64% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.86% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.30% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.24% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.22% | 97.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.17% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.04% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.30% | 95.89% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.05% | 96.77% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.41% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684079 |
| LOTUS | LTS0207961 |
| wikiData | Q105286306 |