5-Methoxy-2-(7-methylfuro[2,3-f][1,3]benzodioxol-6-yl)phenol
| Internal ID | c7bb93df-9313-4dee-9820-8d04d9fb50e6 |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | 5-methoxy-2-(7-methylfuro[2,3-f][1,3]benzodioxol-6-yl)phenol |
| SMILES (Canonical) | CC1=C(OC2=CC3=C(C=C12)OCO3)C4=C(C=C(C=C4)OC)O |
| SMILES (Isomeric) | CC1=C(OC2=CC3=C(C=C12)OCO3)C4=C(C=C(C=C4)OC)O |
| InChI | InChI=1S/C17H14O5/c1-9-12-6-15-16(21-8-20-15)7-14(12)22-17(9)11-4-3-10(19-2)5-13(11)18/h3-7,18H,8H2,1-2H3 |
| InChI Key | QOZSIMBNDMXPNO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 61.10 Ų |
| XlogP | 3.80 |
| There are no found synonyms. |
![2D Structure of 5-Methoxy-2-(7-methylfuro[2,3-f][1,3]benzodioxol-6-yl)phenol](https://plantaedb.com/storage/docs/compounds/2023/11/5-methoxy-2-7-methylfuro23-f13benzodioxol-6-ylphenol.jpg "2D Structure of 5-Methoxy-2-(7-methylfuro[2,3-f][1,3]benzodioxol-6-yl)phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.50% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.81% | 91.49% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.23% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.77% | 95.56% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.79% | 96.77% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 93.52% | 92.51% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.82% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.39% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.76% | 98.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.43% | 92.62% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.74% | 94.80% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 88.49% | 90.24% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.64% | 89.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 86.04% | 98.35% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.96% | 98.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.76% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.73% | 99.17% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.17% | 88.48% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.15% | 93.65% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.08% | 86.33% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.29% | 93.31% |
| CHEMBL240 | Q12809 | HERG | 83.44% | 89.76% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 83.35% | 82.67% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 83.12% | 93.24% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.82% | 95.89% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.82% | 97.36% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.26% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Indigofera microcarpa |
| PubChem | 14134090 |
| LOTUS | LTS0136026 |
| wikiData | Q105225239 |