5-hydroxy-9,10-dimethoxy-1,1,2-trimethyl-2H-furo[2,3-c]xanthen-6-one
| Internal ID | da3d746e-25e9-43a1-bd0b-ac55810b65d5 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 5-hydroxy-9,10-dimethoxy-1,1,2-trimethyl-2H-furo[2,3-c]xanthen-6-one |
| SMILES (Canonical) | CC1C(C2=C(O1)C=C(C3=C2OC4=C(C3=O)C=CC(=C4OC)OC)O)(C)C |
| SMILES (Isomeric) | CC1C(C2=C(O1)C=C(C3=C2OC4=C(C3=O)C=CC(=C4OC)OC)O)(C)C |
| InChI | InChI=1S/C20H20O6/c1-9-20(2,3)15-13(25-9)8-11(21)14-16(22)10-6-7-12(23-4)18(24-5)17(10)26-19(14)15/h6-9,21H,1-5H3 |
| InChI Key | DLXKBRSCEHIVLC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.12598835 g/mol |
| Topological Polar Surface Area (TPSA) | 74.20 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
![2D Structure of 5-hydroxy-9,10-dimethoxy-1,1,2-trimethyl-2H-furo[2,3-c]xanthen-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/5-hydroxy-910-dimethoxy-112-trimethyl-2h-furo23-cxanthen-6-one.jpg "2D Structure of 5-hydroxy-9,10-dimethoxy-1,1,2-trimethyl-2H-furo[2,3-c]xanthen-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.24% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.05% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.89% | 89.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 94.78% | 90.20% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.58% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.12% | 94.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.88% | 94.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.22% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.54% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.06% | 99.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.83% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.82% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.28% | 92.94% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.08% | 97.14% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.48% | 99.15% |
| CHEMBL3194 | P02766 | Transthyretin | 83.16% | 90.71% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.13% | 97.33% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.87% | 80.78% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.12% | 95.89% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.98% | 91.49% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.92% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia vieillardii |
| PubChem | 163000741 |
| LOTUS | LTS0215597 |
| wikiData | Q104984840 |