5-Hydroxy-8-(3,4,5-trihydroxyoxan-2-yl)-2-(3,4,5-trihydroxyphenyl)chromen-4-one
| Internal ID | d28b2216-9910-4dab-8126-c94e86ff5726 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
| IUPAC Name | 5-hydroxy-8-(3,4,5-trihydroxyoxan-2-yl)-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| SMILES (Canonical) | C1C(C(C(C(O1)C2=C3C(=C(C=C2)O)C(=O)C=C(O3)C4=CC(=C(C(=C4)O)O)O)O)O)O |
| SMILES (Isomeric) | C1C(C(C(C(O1)C2=C3C(=C(C=C2)O)C(=O)C=C(O3)C4=CC(=C(C(=C4)O)O)O)O)O)O |
| InChI | InChI=1S/C20H18O10/c21-9-2-1-8(20-18(28)17(27)13(25)6-29-20)19-15(9)10(22)5-14(30-19)7-3-11(23)16(26)12(24)4-7/h1-5,13,17-18,20-21,23-28H,6H2 |
| InChI Key | HDAYHECFOVZYDI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H18O10 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.08999677 g/mol |
| Topological Polar Surface Area (TPSA) | 177.00 Ų |
| XlogP | -0.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.81% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.97% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.82% | 99.15% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.85% | 91.49% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.25% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.23% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.76% | 95.56% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 90.19% | 91.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.89% | 97.09% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 88.72% | 83.10% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.57% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.81% | 99.23% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.43% | 85.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.93% | 94.73% |
| CHEMBL3194 | P02766 | Transthyretin | 83.48% | 90.71% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 82.98% | 91.73% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.76% | 95.89% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.68% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Mucuna sempervirens |
| PubChem | 162898333 |
| LOTUS | LTS0264273 |
| wikiData | Q105026244 |