5-Hydroxy-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid
| Internal ID | 73320929-be35-4cb1-87d2-caaba49f3253 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Secondary alcohols |
| IUPAC Name | 5-hydroxy-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C7H8O4/c8-4-1-3(7(9)10)2-5-6(4)11-5/h2,4-6,8H,1H2,(H,9,10) |
| InChI Key | HCJYBFJCLBWRFY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04225873 g/mol |
| Topological Polar Surface Area (TPSA) | 70.10 Ų |
| XlogP | -0.70 |
| There are no found synonyms. |
![2D Structure of 5-Hydroxy-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/5-hydroxy-7-oxabicyclo410hept-2-ene-3-carboxylic-acid.jpg "2D Structure of 5-Hydroxy-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.28% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.54% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.01% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.98% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hypericum henryi |
| PubChem | 22667291 |
| LOTUS | LTS0230687 |
| wikiData | Q105025778 |