5-Hydroxy-7-methoxy-3-[(4-methoxyphenyl)methyl]-2,3-dihydrochromen-4-one
Internal ID | 2f22ea99-3573-4f85-9f97-cae84ea3e65c |
Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids > Homoisoflavans > Homoisoflavanones |
IUPAC Name | 5-hydroxy-7-methoxy-3-[(4-methoxyphenyl)methyl]-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC=C(C=C1)CC2COC3=CC(=CC(=C3C2=O)O)OC |
SMILES (Isomeric) | COC1=CC=C(C=C1)CC2COC3=CC(=CC(=C3C2=O)O)OC |
InChI | InChI=1S/C18H18O5/c1-21-13-5-3-11(4-6-13)7-12-10-23-16-9-14(22-2)8-15(19)17(16)18(12)20/h3-6,8-9,12,19H,7,10H2,1-2H3 |
InChI Key | HLUBAGIRQBMMAQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H18O5 |
Molecular Weight | 314.30 g/mol |
Exact Mass | 314.11542367 g/mol |
Topological Polar Surface Area (TPSA) | 65.00 Ų |
XlogP | 3.50 |
There are no found synonyms. |
![2D Structure of 5-Hydroxy-7-methoxy-3-[(4-methoxyphenyl)methyl]-2,3-dihydrochromen-4-one 2D Structure of 5-Hydroxy-7-methoxy-3-[(4-methoxyphenyl)methyl]-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/5-hydroxy-7-methoxy-3-4-methoxyphenylmethyl-23-dihydrochromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.41% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.12% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.09% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.76% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.56% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.57% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.42% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.82% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.20% | 99.15% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.61% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.77% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.30% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.10% | 92.62% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.67% | 93.99% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.66% | 85.14% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.67% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 83.12% | 98.75% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.74% | 93.40% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.54% | 95.53% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.02% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Schizocarphus nervosus |
PubChem | 11324481 |
LOTUS | LTS0079206 |
wikiData | Q105030298 |