5-Hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-(4-hydroxyphenyl)hepta-4,6-dien-3-one
Internal ID | e6c94e27-7397-47bf-86e7-cae76a6271da |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids > Curcuminoids |
IUPAC Name | 5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-(4-hydroxyphenyl)hepta-4,6-dien-3-one |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=CC(=O)CCC2=CC=C(C=C2)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C=CC(=CC(=O)CCC2=CC=C(C=C2)O)O)O |
InChI | InChI=1S/C20H20O5/c1-25-20-12-15(6-11-19(20)24)5-10-18(23)13-17(22)9-4-14-2-7-16(21)8-3-14/h2-3,5-8,10-13,21,23-24H,4,9H2,1H3 |
InChI Key | ZNVIPQYJPLZSBC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H20O5 |
Molecular Weight | 340.40 g/mol |
Exact Mass | 340.13107373 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 3.80 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.22% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.17% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.63% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.88% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 94.42% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.19% | 96.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 92.80% | 95.50% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 92.23% | 90.20% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.08% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.12% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 86.42% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.04% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 84.66% | 98.75% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.12% | 96.95% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.20% | 91.71% |
CHEMBL1921 | P47901 | Vasopressin V1b receptor | 80.49% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Curcuma longa |
PubChem | 129864110 |
LOTUS | LTS0161650 |
wikiData | Q105380246 |