5-Hydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyfuro[3,2-h]chromen-8-one
| Internal ID | d0dbd2ea-f74e-4ba1-b4db-108d0c68c787 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Coumarin glycosides |
| IUPAC Name | 5-hydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyfuro[3,2-h]chromen-8-one |
| SMILES (Canonical) | C1=CC(=O)OC2=C3C(=C(C(=C21)O)OC4C(C(C(C(O4)CO)O)O)O)C=CO3 |
| SMILES (Isomeric) | C1=CC(=O)OC2=C3C(=C(C(=C21)O)OC4C(C(C(C(O4)CO)O)O)O)C=CO3 |
| InChI | InChI=1S/C17H16O10/c18-5-8-11(21)12(22)13(23)17(25-8)27-14-7-3-4-24-15(7)16-6(10(14)20)1-2-9(19)26-16/h1-4,8,11-13,17-18,20-23H,5H2 |
| InChI Key | VVCCTDFSTNPCFL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H16O10 |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.07434670 g/mol |
| Topological Polar Surface Area (TPSA) | 159.00 Ų |
| XlogP | -0.20 |
| There are no found synonyms. |
![2D Structure of 5-Hydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyfuro[3,2-h]chromen-8-one](https://plantaedb.com/storage/docs/compounds/2023/11/5-hydroxy-4-345-trihydroxy-6-hydroxymethyloxan-2-yloxyfuro32-hchromen-8-one.jpg "2D Structure of 5-Hydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyfuro[3,2-h]chromen-8-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.19% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.82% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.23% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.04% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.20% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.83% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.86% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.21% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.35% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.19% | 99.17% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.85% | 95.83% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 80.57% | 94.03% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.39% | 94.73% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 80.38% | 96.37% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.32% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ficus ruficaulis |
| PubChem | 162944970 |
| LOTUS | LTS0070802 |
| wikiData | Q105297586 |