5-Hydroxy-3-[(4-hydroxyphenyl)methylidene]-7-methoxychromen-4-one
Internal ID | 05782bb5-dc51-45c7-a1bf-92e06903a396 |
Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids |
IUPAC Name | 5-hydroxy-3-[(4-hydroxyphenyl)methylidene]-7-methoxychromen-4-one |
SMILES (Canonical) | COC1=CC(=C2C(=C1)OCC(=CC3=CC=C(C=C3)O)C2=O)O |
SMILES (Isomeric) | COC1=CC(=C2C(=C1)OCC(=CC3=CC=C(C=C3)O)C2=O)O |
InChI | InChI=1S/C17H14O5/c1-21-13-7-14(19)16-15(8-13)22-9-11(17(16)20)6-10-2-4-12(18)5-3-10/h2-8,18-19H,9H2,1H3 |
InChI Key | CEIWQXCJVAWOKP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H14O5 |
Molecular Weight | 298.29 g/mol |
Exact Mass | 298.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 3.10 |
There are no found synonyms. |
![2D Structure of 5-Hydroxy-3-[(4-hydroxyphenyl)methylidene]-7-methoxychromen-4-one 2D Structure of 5-Hydroxy-3-[(4-hydroxyphenyl)methylidene]-7-methoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/5-hydroxy-3-4-hydroxyphenylmethylidene-7-methoxychromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.21% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.43% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.34% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.84% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 90.43% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.77% | 89.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 89.50% | 96.12% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.30% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.71% | 99.15% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.35% | 93.40% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.27% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.46% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.58% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.35% | 95.89% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.85% | 92.68% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.36% | 93.99% |
CHEMBL3194 | P02766 | Transthyretin | 80.84% | 90.71% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.60% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Schizocarphus nervosus |
PubChem | 53438928 |
LOTUS | LTS0119391 |
wikiData | Q104955728 |