5-Hydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one
| Internal ID | a6b96090-43ba-422d-af2c-fb0296491e9e |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflav-2-enes > Isoflavones |
| IUPAC Name | 5-hydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one |
| SMILES (Canonical) | COC1=C(C2=C(C=C1)OC=C(C2=O)C3=CC=C(C=C3)O)O |
| SMILES (Isomeric) | COC1=C(C2=C(C=C1)OC=C(C2=O)C3=CC=C(C=C3)O)O |
| InChI | InChI=1S/C16H12O5/c1-20-13-7-6-12-14(16(13)19)15(18)11(8-21-12)9-2-4-10(17)5-3-9/h2-8,17,19H,1H3 |
| InChI Key | OWOLPTZIAWJNPY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.50% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.48% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.69% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.44% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.62% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.64% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.06% | 85.14% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.59% | 90.20% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.30% | 95.78% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.74% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.49% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.81% | 96.09% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.42% | 86.92% |
| CHEMBL3194 | P02766 | Transthyretin | 80.55% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Wisteria brachybotrys |
| PubChem | 13965472 |
| LOTUS | LTS0091976 |
| wikiData | Q105202168 |