5-Hydroxy-3-(4-hydroxybenzyl)-7,8-dimethoxy-4-chromanone
Internal ID | ea7ac3ad-a910-43f2-bd93-f59819e300ce |
Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids > Homoisoflavans > Homoisoflavanones |
IUPAC Name | 5-hydroxy-3-[(4-hydroxyphenyl)methyl]-7,8-dimethoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=C(C2=C(C(=C1)O)C(=O)C(CO2)CC3=CC=C(C=C3)O)OC |
SMILES (Isomeric) | COC1=C(C2=C(C(=C1)O)C(=O)C(CO2)CC3=CC=C(C=C3)O)OC |
InChI | InChI=1S/C18H18O6/c1-22-14-8-13(20)15-16(21)11(9-24-18(15)17(14)23-2)7-10-3-5-12(19)6-4-10/h3-6,8,11,19-20H,7,9H2,1-2H3 |
InChI Key | GMCVGMAGOGOINY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H18O6 |
Molecular Weight | 330.30 g/mol |
Exact Mass | 330.11033829 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 3.20 |
7-O-Methyl-3,9-dihydropunctatin |
CHEBI:175209 |
DTXSID301127460 |
2,3-Dihydro-5-hydroxy-3-[(4-hydroxyphenyl)methyl]-7,8-dimethoxy-4H-1-benzopyran-4-one |
5-hydroxy-3-[(4-hydroxyphenyl)methyl]-7,8-dimethoxy-2,3-dihydrochromen-4-one |
5-hydroxy-3-[(4-hydroxyphenyl)methyl]-7,8-dimethoxy-3,4-dihydro-2H-1-benzopyran-4-one |
93078-82-1 |
![2D Structure of 5-Hydroxy-3-(4-hydroxybenzyl)-7,8-dimethoxy-4-chromanone 2D Structure of 5-Hydroxy-3-(4-hydroxybenzyl)-7,8-dimethoxy-4-chromanone](https://plantaedb.com/storage/docs/compounds/2023/11/5-hydroxy-3-4-hydroxybenzyl-78-dimethoxy-4-chromanone.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.18% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.83% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.17% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.96% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.19% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.10% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.05% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.61% | 86.33% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.14% | 83.82% |
CHEMBL2535 | P11166 | Glucose transporter | 88.08% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.53% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.50% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.86% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.47% | 85.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.00% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.56% | 89.00% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.96% | 95.53% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.48% | 95.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.79% | 97.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.71% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Leopoldia comosa |
PubChem | 21627906 |
LOTUS | LTS0144409 |
wikiData | Q105011688 |