CID 139585681
| Internal ID | 39960540-c8a7-4252-a03d-f42877e672d9 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles > 3-alkylindoles |
| IUPAC Name | 5-hydroxy-3-(1H-indol-3-ylmethyl)piperidin-2-one |
| SMILES (Canonical) | C1C(CNC(=O)C1CC2=CNC3=CC=CC=C32)O |
| SMILES (Isomeric) | C1C(CNC(=O)C1CC2=CNC3=CC=CC=C32)O |
| InChI | InChI=1S/C14H16N2O2/c17-11-6-9(14(18)16-8-11)5-10-7-15-13-4-2-1-3-12(10)13/h1-4,7,9,11,15,17H,5-6,8H2,(H,16,18) |
| InChI Key | NUXHSAAEUDFPJT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.121177757 g/mol |
| Topological Polar Surface Area (TPSA) | 65.10 Ų |
| XlogP | 1.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.93% | 91.11% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 95.90% | 88.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.25% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.21% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.61% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.49% | 93.99% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.16% | 98.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.63% | 92.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.52% | 89.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.87% | 98.59% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 90.57% | 95.56% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 89.41% | 90.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.36% | 90.08% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.77% | 83.82% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.70% | 99.23% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 86.59% | 83.10% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.60% | 94.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.51% | 98.75% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.24% | 94.75% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.23% | 89.62% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 81.79% | 96.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 81.44% | 97.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139585681 |
| LOTUS | LTS0078147 |
| wikiData | Q77489252 |