5-Hydroxy-2-methoxy-6-oxa-benzo[def]chrysen-1-one
Internal ID | ffb6e520-a51d-4f98-b605-b9d71484abae |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthenes > Benzoxanthenes |
IUPAC Name | 10-hydroxy-14-methoxy-8-oxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,13,16(20),17-nonaen-15-one |
SMILES (Canonical) | COC1=CC2=CC(=C3C4=C(C=CC(=C24)C1=O)C5=CC=CC=C5O3)O |
SMILES (Isomeric) | COC1=CC2=CC(=C3C4=C(C=CC(=C24)C1=O)C5=CC=CC=C5O3)O |
InChI | InChI=1S/C20H12O4/c1-23-16-9-10-8-14(21)20-18-12(6-7-13(17(10)18)19(16)22)11-4-2-3-5-15(11)24-20/h2-9,21H,1H3 |
InChI Key | MYICUMRUDLMCKG-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C20H12O4 |
Molecular Weight | 316.30 g/mol |
Exact Mass | 316.07355886 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 4.20 |
5-hydroxy-2-methoxy-6-oxa-benzo[def]chrysen-1-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.58% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.63% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.52% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.17% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.95% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.31% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 91.58% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.23% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 90.90% | 98.75% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.91% | 93.99% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.73% | 93.65% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.41% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.27% | 92.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.15% | 94.73% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.75% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Wachendorfia thyrsiflora |
Xiphidium caeruleum |
PubChem | 21592294 |
LOTUS | LTS0092674 |
wikiData | Q105174933 |